CAS 467-55-0: hecogenin
Description:Hecogenin is a naturally occurring steroid sapogenin derived from various plant sources, particularly from the genus Agave. It is characterized by its molecular structure, which includes a steroid backbone with specific functional groups that contribute to its biological activity. Hecogenin is a white to off-white crystalline powder that is insoluble in water but soluble in organic solvents such as ethanol and chloroform. Its chemical formula is C27H44O3, and it has a molecular weight of approximately 416.65 g/mol. Hecogenin is known for its potential pharmacological properties, including anti-inflammatory and anti-cancer activities, making it of interest in medicinal chemistry and pharmaceutical research. Additionally, it serves as a precursor in the synthesis of various steroid hormones and other bioactive compounds. Due to its natural origin and biological significance, hecogenin is studied for its applications in traditional medicine and modern therapeutic formulations.
Formula:C27H42O4
InChI:InChI=1S/C27H42O4/c1-15-7-10-27(30-14-15)16(2)24-22(31-27)12-21-19-6-5-17-11-18(28)8-9-25(17,3)20(19)13-23(29)26(21,24)4/h15-22,24,28H,5-14H2,1-4H3/t15-,16+,17+,18+,19-,20+,21+,22+,24+,25+,26-,27-/m1/s1
InChI key:InChIKey=QOLRLLFJMZLYQJ-LOBDNJQFSA-N
SMILES:O=C1CC2C(CCC3CC(O)CCC32C)C4CC5OC6(OCC(C)CC6)C(C)C5C14C
- Synonyms:
- (25R)-3b-Hydroxy-5a-spirostan-12-one
- (3Beta,5Alpha,22Xi)-3-Hydroxyspirostan-12-One
- (3Beta,5Alpha,8Xi,9Xi,14Xi,16Xi,17Xi,20Xi,22Xi)-3-Hydroxyspirostan-12-One
- (3beta,5alpha,25R)-3-hydroxyspirostan-12-one
- (3β,5α,25R)-3-Hydroxyspirostan-12-one
- 12-Oxotigogenin
- 25(R)-3β-Hydroxyspirostan-12-one
- 3-Beta-Hydroxy-5-Alpha-Spirostan-12-One
- 3-Hydroxyspirostan-12-One
- 3beta-Hydroxy-5alpha-spirostan-12-one
- See more synonyms
- 3β-Hydroxy-5α-hecogenin
- 5α,25<span class="text-smallcaps">D</span>-Spirostan-12-one, 3β-hydroxy-
- 5α-Spirostan-12-one, 3β-hydroxy-, (25R)-
- Gekogenin
- Hekogenin
- Hocogenin
- NSC 115921
- Spirostan-12-one, 3-hydroxy-, (3β,5α,25R)-
