CAS 467-81-2
:(22β)-22-[[(2Z)-2-Methyl-1-oxo-2-buten-1-yl]oxy]-3-oxoolean-12-en-28-oic acid
Description:
The chemical substance known as "(22β)-22-[[(2Z)-2-Methyl-1-oxo-2-buten-1-yl]oxy]-3-oxoolean-12-en-28-oic acid," with the CAS number 467-81-2, is a naturally occurring compound classified as a triterpenoid. It is derived from the oleanane family of compounds, which are characterized by a specific tetracyclic structure. This substance exhibits a range of biological activities, including potential anti-inflammatory and anticancer properties, making it of interest in pharmacological research. Its structure features a functional group that includes a butenyl moiety, contributing to its reactivity and interaction with biological systems. The presence of the carboxylic acid group in its structure indicates that it can participate in various chemical reactions, including esterification and acid-base reactions. Additionally, the compound's stereochemistry, particularly at the 22β position, plays a crucial role in determining its biological activity and interaction with cellular targets. Overall, this compound represents a significant area of study in natural product chemistry and medicinal applications.
Formula:C35H52O5
InChI:InChI=1S/C35H52O5/c1-10-21(2)28(37)40-27-20-30(3,4)19-23-22-11-12-25-32(7)15-14-26(36)31(5,6)24(32)13-16-34(25,9)33(22,8)17-18-35(23,27)29(38)39/h10-11,23-25,27H,12-20H2,1-9H3,(H,38,39)/b21-10-/t23-,24-,25+,27+,32-,33+,34+,35-/m0/s1
InChI key:InChIKey=KCLIRHUTOPOHKJ-LSZVMECJSA-N
SMILES:C(O)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)C(=O)CC5)[H])[H])(CC(C)(C)C[C@H]2OC(/C(=C\C)/C)=O)[H]
Synonyms:- (22β)-22-[[(2Z)-2-Methyl-1-oxo-2-buten-1-yl]oxy]-3-oxoolean-12-en-28-oic acid
- Lantadene A
- Olean-12-en-28-oic acid, 22-[(2-methyl-1-oxo-2-butenyl)oxy]-3-oxo-, [22β(Z)]-
- Olean-12-en-28-oic acid, 22-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]-3-oxo-, (22β)-
- Olean-12-en-28-oic acid, 22-[[(2Z)-2-methyl-1-oxo-2-butenyl]oxy]-3-oxo-, (22β)-
- Olean-12-en-28-oic acid, 22β-hydroxy-3-oxo-, 2-methylcrotonate, (Z)-
- Rehmannic acid
- olean-12-en-28-oic acid, 22-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]-3-oxo-, methyl ester, (22beta)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Rehmannic acid
CAS:Rehmannic acid and oleanolic acetate inhibit succinoxidase activity.Formula:C35H52O5Purity:98%Color and Shape:SolidMolecular weight:552.78Lantadene A
CAS:Controlled Product<p>Lantadene A is a pentacyclic triterpenoid, which is a natural compound extracted from the leaves of the Lantana camara plant. This compound is primarily known for its hepatotoxic properties, which occur through inhibition of liver mitochondrial functions, affecting cellular energy production and leading to cell damage. This mode of action is particularly relevant in the study of plant-induced liver toxicity.</p>Formula:C35H52O5Purity:Min. 95%Molecular weight:552.8 g/mol



