CAS 467235-27-4

(2S)-2-(bromomethyl)-8-(4-chlorophenoxy)-2-hydroxy-octanoic acid

Description:

(2S)-2-(bromomethyl)-8-(4-chlorophenoxy)-2-hydroxy-octanoic acid is a chemical compound characterized by its specific stereochemistry and functional groups. It features a bromomethyl group, which introduces a bromine atom attached to a carbon chain, enhancing its reactivity. The presence of a hydroxyl group (-OH) indicates that it is an alcohol, contributing to its solubility in polar solvents and potential for hydrogen bonding. The octanoic acid backbone suggests that it is a fatty acid derivative, which may influence its biological activity and interactions with lipid membranes. The 4-chlorophenoxy moiety indicates the presence of a chlorinated aromatic ring, which can impart unique electronic properties and enhance lipophilicity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for various applications in medicinal chemistry or as a biochemical probe. Its specific stereochemistry (2S) is crucial for its biological activity, as chirality can significantly affect how a molecule interacts with biological systems.

Formula: C₁₅H₂₀BrClO₄

InChI: InChI=1/C15H20BrClO4/c16-11-15(20,14(18)19)9-3-1-2-4-10-21-13-7-5-12(17)6-8-13/h5-8,20H,1-4,9-11H2,(H,18,19)/t15-/m1/s1

InChI key: InChIKey=DWOYOYYLEZEUMR-OAHLLOKOSA-N

SMILES: C(CCCOc1ccc(cc1)Cl)CC[C@@](CBr)(C(=O)O)O