CAS 46755-94-6
:(2S)-1,1-Diphenyl-1,2-propanediol
Description:
(2S)-1,1-Diphenyl-1,2-propanediol, with the CAS number 46755-94-6, is an organic compound characterized by its chiral structure, featuring two phenyl groups attached to a central carbon atom that is also bonded to two hydroxyl (-OH) groups. This compound is a diol, indicating the presence of two alcohol functional groups, which contribute to its solubility in polar solvents. The stereochemistry of the molecule is significant, as the (2S) designation indicates the specific spatial arrangement of the atoms around the chiral center, influencing its reactivity and interactions in chemical processes. Typically, compounds like this can exhibit interesting properties such as potential use in asymmetric synthesis or as intermediates in organic reactions. Additionally, the presence of the diphenyl groups may impart unique physical properties, such as increased stability and potential applications in pharmaceuticals or materials science. Overall, (2S)-1,1-Diphenyl-1,2-propanediol is notable for its structural complexity and potential utility in various chemical applications.
Formula:C15H16O2
InChI:InChI=1S/C15H16O2/c1-12(16)15(17,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,16-17H,1H3/t12-/m0/s1
InChI key:InChIKey=RQKXFLUAQLDHMO-LBPRGKRZSA-N
SMILES:C([C@H](C)O)(O)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- (-)-1,1-Diphenyl-1,2-propanediol
- (2S)-1,1-Diphenyl-1,2-propanediol
- (2S)-1,1-diphenylpropane-1,2-diol
- 1,2-Propanediol, 1,1-diphenyl-, (2S)-
- 1,2-Propanediol, 1,1-diphenyl-, (S)-
- l-1,2-Propanediol, 1,1-diphenyl-
- (S)-(?-1,1-Diphenyl-1,2-propanediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(S)-1,1-Diphenylpropane-1,2-diol
CAS:Formula:C15H16O2Purity:%Color and Shape:SolidMolecular weight:228.2863
