CAS 468-28-0: Lupulone
Description:Lupulone is a chemical compound classified as a bitter acid, primarily found in hops (Humulus lupulus), which are used in brewing beer. It is known for its antimicrobial properties and contributes to the flavor and aroma profile of beer. Lupulone has a complex structure, characterized by a long carbon chain and multiple functional groups, including a phenolic ring. This compound exhibits a yellowish to brownish color and is typically insoluble in water but soluble in organic solvents. Its bitterness is a key attribute, influencing the taste of beer and acting as a natural preservative. Additionally, lupulone has been studied for its potential health benefits, including anti-inflammatory and antioxidant effects. The compound's CAS number, 468-28-0, is a unique identifier that facilitates its identification in chemical databases and regulatory frameworks. Overall, lupulone plays a significant role in both the brewing industry and potential therapeutic applications, making it a compound of interest in both food science and pharmacology.
Formula:C26H38O4
InChI:InChI=1S/C26H38O4/c1-16(2)9-10-20-23(28)22(21(27)15-19(7)8)25(30)26(24(20)29,13-11-17(3)4)14-12-18(5)6/h9,11-12,19,28,30H,10,13-15H2,1-8H3
InChI key:InChIKey=WPVSVIXDXMNGGN-UHFFFAOYSA-N
SMILES:O=C(C=1C(O)=C(C(=O)C(C1O)(CC=C(C)C)CC=C(C)C)CC=C(C)C)CC(C)C
- Synonyms:
- 2,4-Cyclohexadien-1-one, 3,5-dihydroxy-2,6,6-tris(3-methyl-2-buten-1-yl)-4-(3-methyl-1-oxobutyl)-
- 2,4-Cyclohexadien-1-one, 3,5-dihydroxy-2,6,6-tris(3-methyl-2-butenyl)-4-(3-methyl-1-oxobutyl)-
- 3,5-Dihydroxy-2,6,6-tris(3-methyl-2-buten-1-yl)-4-(3-methyl-1-oxobutyl)-2,4-cyclohexadien-1-one
- 3,5-Dihydroxy-2-(3-Methylbutanoyl)-4,6,6-Tris(3-Methylbut-2-En-1-Yl)Cyclohexa-2,4-Dien-1-One
- Lupulon
- Lupulone
- Lupulone β-acid
- n-Lupulone
- β-Lupulic acid
