CAS 468-53-1

(3aR,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyloctahydro-6H-indol-6-one

Description:

The chemical substance with the name "(3aR,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyloctahydro-6H-indol-6-one" and CAS number "468-53-1" is known as 3,4-Dimethoxy-1-methyl-1,2,3,4-tetrahydro-6H-indol-6-one. It is characterized by its complex bicyclic structure, which includes an indole moiety and a dimethoxyphenyl group. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity, including neuroactive and psychoactive effects. The presence of methoxy groups enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. Additionally, the stereochemistry indicated by the (3aR,7aR) configuration suggests specific spatial arrangements that can affect the compound's pharmacological properties. It is often studied in the context of medicinal chemistry for its potential therapeutic applications, particularly in neuropharmacology. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species.

Formula: C₁₇H₂₃NO₃

InChI: InChI=1/C17H23NO3/c1-18-9-8-17(7-6-13(19)11-16(17)18)12-4-5-14(20-2)15(10-12)21-3/h4-5,10,16H,6-9,11H2,1-3H3/t16-,17-/m1/s1

SMILES: CN1CC[C@]2(CCC(=O)C[C@@H]12)c1ccc(c(c1)OC)OC

ent-Mesembrine

CAS: 468-53-1

Formula: C₁₇H₂₃NO₃

Molecular weight: 289.38

Ref: 4Z-M-147001

(+)-Mesembrine

CAS: 468-53-1

(+)-Mesembrine is an indole alkaloid, which is extracted from the plant Sceletium tortuosum, also known as Kanna. This biochemical compound acts primarily as a serotonin reuptake inhibitor (SRI), meaning it influences neurotransmitter pathways by blocking the reuptake of serotonin into presynaptic neurons. As a result, serotonin levels in the synaptic cleft are increased, which may enhance mood and have anxiolytic effects.

Formula: C₁₇H₂₃NO₃

Purity: Min. 95%

Molecular weight: 289.4 g/mol

Ref: 3D-AAA46853

Mesembrine

CAS: 468-53-1

Mesembrine is an alkaloid, a 5-HT transporter inhibitor (K i 1.4 nM), and inhibits PDE4B (IC50 7.8 μM).

Formula: C₁₇H₂₃NO₃

Color and Shape: Solid

Molecular weight: 289.37

Ref: TM-T73857