CAS 4682-48-8
:Lactosylceramide
Description:
Lactosylceramide, with the CAS number 4682-48-8, is a glycosphingolipid that plays a significant role in cellular recognition and signaling processes. It is composed of a ceramide backbone linked to a lactose sugar moiety, which contributes to its amphipathic nature, allowing it to integrate into biological membranes. This compound is primarily found in the membranes of various cell types, particularly in the brain and other nervous tissues, where it is involved in cell-cell interactions and the formation of lipid rafts. Lactosylceramide is also implicated in various biological processes, including cell adhesion, differentiation, and apoptosis. Its structure allows it to participate in the formation of complex glycosphingolipid networks, which are essential for maintaining cellular integrity and function. Additionally, alterations in lactosylceramide levels have been associated with certain pathological conditions, including neurodegenerative diseases and cancer, making it a subject of interest in biomedical research. Overall, lactosylceramide is a crucial component of cellular architecture and signaling pathways.
Formula:Unspecified
InChI:InChI=1/C48H91NO13/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-40(53)49-36(37(52)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2)35-59-47-45(58)43(56)46(39(34-51)61-47)62-48-44(57)42(55)41(54)38(33-50)60-48/h29,31,36-39,41-48,50-52,54-58H,3-28,30,32-35H2,1-2H3,(H,49,53)/b31-29+/t36?,37?,38-,39-,41+,42+,43-,44-,45-,46+,47-,48?/m1/s1
Synonyms:- CDw17 antigen
- Cdh
- Ceramide lactoside
- Ceramide, 1-O-(4-O-β-<span class="text-smallcaps">D</smallcap>-galactopyranosyl-β-<smallcap>D</span>-glucopyranosyl)-
- Ceramide-β-<span class="text-smallcaps">D</span>-lactoside
- Cytolipin H
- Ganglioside G<sub>A3</sub>
- Ganglioside G<sub>L2a</sub>
- LacCer
- Lactocerebrosides Bovine
- Lactosyl Ceramide, Bovine
- Lactosyl Ceramide, Porcine
- Lactosylceramide
- Lmcdh 1
- N-[(3E)-1-{[(4-O-D-galactopyranosyl-beta-D-galactopyranosyl)oxy]methyl}-2-hydroxyheptadec-3-en-1-yl]octadecanamide
- N-lignoceroyl-1-sphingosyl lactoside
- Ceramide, 1-O-(4-O-β-D-galactopyranosyl-β-D-glucopyranosyl)-
- Ganglioside GL2a
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Lactosylceramides (bovine buttermilk)
CAS:<p>Lactosylceramides (bovine buttermilk) (LacCer (bovine buttermilk)) is a ceramide isolated from bovine buttermilk that can be used to study liver lesions.</p>Formula:C53H101NO13(fortricosanoyl)Color and Shape:SolidMolecular weight:960.4Lactosylceramide
CAS:<p>Asialylated glycosphingolipid and precursor for ganglioside biosynthesis. The compound is a major glycosphingolipid in human neutrophils and is involved in the regulation of superoxides as well as nitric oxide. Moreover, lactosylceramide accumulates in atherosclerotic plaques and is also found elevated in familial hypercholesterolemia and polycystic kidney disease. Animal studies revealed that lactosylceramide induces hypertrophy in cardiomyocytes via signal transduction pathway that is oxygen-sensitive.</p>Formula:C53H101NO13Purity:Min. 90 Area-%Color and Shape:White Yellow PowderMolecular weight:960.37 g/mol





