CAS 46833-85-6
:3-[(3-cyanophenyl)methyl]benzonitrile
Description:
3-[(3-Cyanophenyl)methyl]benzonitrile, identified by its CAS number 46833-85-6, is an organic compound characterized by its aromatic structure and the presence of both a benzonitrile and a cyanophenyl group. This compound features a central benzonitrile moiety, which consists of a benzene ring attached to a nitrile (–C≡N) functional group, contributing to its chemical reactivity and potential applications in organic synthesis. The presence of the 3-cyanophenyl group introduces additional functional complexity, potentially influencing its electronic properties and solubility. Typically, compounds like this may exhibit properties such as moderate to high melting points, depending on their molecular interactions, and may be soluble in organic solvents. The nitrile group can participate in various chemical reactions, including nucleophilic additions and cycloadditions, making this compound of interest in medicinal chemistry and materials science. Its specific applications would depend on its reactivity and the functional groups present, which could be explored in further research and development contexts.
Formula:C15H10N2
InChI:InChI=1/C15H10N2/c16-10-14-5-1-3-12(8-14)7-13-4-2-6-15(9-13)11-17/h1-6,8-9H,7H2
SMILES:c1cc(Cc2cccc(c2)C#N)cc(c1)C#N
Synonyms:- 3,3'-Methylenedibenzonitrile
- Benzonitrile, 3,3'-methylenebis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
