CAS 4684-87-1
:Octamoxin
Description:
Octamoxin, identified by its CAS number 4684-87-1, is a chemical compound that belongs to the class of organic compounds known as amines. It is characterized by its molecular structure, which typically includes multiple functional groups that contribute to its reactivity and properties. Octamoxin is often utilized in various applications, including pharmaceuticals and agrochemicals, due to its biological activity. The compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its stability can be influenced by environmental factors such as pH and temperature. Additionally, Octamoxin may possess certain toxicological properties, necessitating careful handling and usage guidelines. As with many chemical substances, understanding its safety profile, including potential hazards and environmental impact, is crucial for its application in industrial and research settings. Always refer to safety data sheets and regulatory guidelines for comprehensive information regarding handling and usage.
Formula:C8H20N2
InChI:InChI=1S/C8H20N2/c1-3-4-5-6-7-8(2)10-9/h8,10H,3-7,9H2,1-2H3
InChI key:InChIKey=FODQIVGFADUBKE-UHFFFAOYSA-N
SMILES:C(CCCCCC)(NN)C
Synonyms:- Octomoxine
- Hydrazine, (1-methylheptyl)-
- Octamoxine
- (1-Methylheptyl)hydrazine
- Octamoxin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
