CAS 468740-43-4: 4-{[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino}-3-(4-methyl-6-morpholin-4-yl-1H-benzimidazol-2-yl)pyridin-2(1H)-one
Description:The chemical substance known as 4-{[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino}-3-(4-methyl-6-morpholin-4-yl-1H-benzimidazol-2-yl)pyridin-2(1H)-one, with the CAS number 468740-43-4, is a complex organic compound characterized by its multi-functional structure. It features a pyridinone core, which is a bicyclic compound containing a pyridine ring fused to a lactam. The presence of a benzimidazole moiety contributes to its potential biological activity, while the morpholine and chlorophenyl groups enhance its solubility and interaction with biological targets. The compound is likely to exhibit properties such as moderate to high lipophilicity due to the aromatic and aliphatic components, which may influence its pharmacokinetics. Additionally, the hydroxyl and amino functional groups suggest potential for hydrogen bonding, which can affect its binding affinity to biological receptors. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of therapeutic agents targeting specific diseases.
Formula:C25H26ClN5O3
InChI:InChI=1/C25H26ClN5O3/c1-15-11-18(31-7-9-34-10-8-31)13-20-23(15)30-24(29-20)22-19(5-6-27-25(22)33)28-14-21(32)16-3-2-4-17(26)12-16/h2-6,11-13,21,32H,7-10,14H2,1H3,(H,29,30)(H2,27,28,33)/t21-/m1/s1