CAS 469-23-8

(3aS,8aR)-5-Ethoxy-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indole

Description:

The chemical substance known as (3aS,8aR)-5-Ethoxy-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indole, with the CAS number 469-23-8, is a complex organic compound characterized by its unique bicyclic structure that incorporates a pyrroloindole framework. This compound features multiple chiral centers, contributing to its stereochemistry, which is crucial for its biological activity. The presence of an ethoxy group enhances its solubility and may influence its pharmacokinetic properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. The structural complexity and stereochemical configuration suggest that it may exhibit specific interactions with receptors or enzymes, making it a subject of interest in drug discovery and development. Additionally, its stability and reactivity can be influenced by the functional groups present, which are essential for understanding its behavior in various chemical environments.

Formula: C₁₅H₂₂N₂O

InChI: InChI=1S/C15H22N2O/c1-5-18-11-6-7-13-12(10-11)15(2)8-9-16(3)14(15)17(13)4/h6-7,10,14H,5,8-9H2,1-4H3/t14-,15+/m1/s1

InChI key: InChIKey=KQWOEHQIZVGMMT-CABCVRRESA-N

SMILES: C[C@]12C=3C(N(C)[C@]1(N(C)CC2)[H])=CC=C(OCC)C3

Synonyms:

• (-)-Eserethole
• (3aS,8aR)-5-Ethoxy-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indole
• Eserethole(6CI,8CI)
• Eseretole
• Pyrrolo[2,3-b]indole, 5-ethoxy-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-,(3aS-cis)-
• Pyrrolo[2,3-b]indole, 5-ethoxy-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, (3aS,8aR)-
• Eserethol

Eserethol

Controlled Product

CAS: 469-23-8

Formula: C₁₅H₂₂N₂O

Color and Shape: Dark Red

Molecular weight: 246.35

Ref: TR-E146220

Eserethol

CAS: 469-23-8

Eserethol is a bioactive compound derived from natural plant sources, which exhibits a unique mode of action by modulating specific cellular pathways. This product leverages its origins in carefully selected botanicals to interact with intracellular signaling cascades, thereby exerting influence on various biochemical processes.

Formula: C₁₅H₂₂N₂O

Purity: Min. 95%

Molecular weight: 246.35 g/mol

Ref: 3D-AAA46923