CAS 469-38-5
:Cycloartenol
Description:
Cycloartenol is a triterpenoid compound classified as a sterol, primarily found in various plant species, particularly in the family of Asteraceae. It is characterized by its complex tetracyclic structure, which includes a cyclopropane ring, contributing to its unique chemical properties. Cycloartenol is a precursor in the biosynthesis of phytosterols, which are important for plant cell membrane integrity and function. The compound is typically a white to pale yellow solid at room temperature and is insoluble in water but soluble in organic solvents such as ethanol and chloroform. Its molecular formula is C30H50O, and it exhibits a melting point that varies depending on purity and specific conditions. Cycloartenol has garnered interest in various fields, including pharmacology and nutrition, due to its potential health benefits, such as cholesterol-lowering effects and anti-inflammatory properties. Additionally, it serves as a valuable intermediate in the synthesis of other bioactive compounds, making it significant in both natural product chemistry and industrial applications.
Formula:C30H50O
InChI:InChI=1S/C30H50O/c1-20(2)9-8-10-21(3)22-13-15-28(7)24-12-11-23-26(4,5)25(31)14-16-29(23)19-30(24,29)18-17-27(22,28)6/h9,21-25,31H,8,10-19H2,1-7H3/t21-,22-,23+,24+,25+,27-,28+,29-,30+/m1/s1
InChI key:InChIKey=ONQRKEUAIJMULO-YBXTVTTCSA-N
SMILES:C[C@]12[C@]3([C@]4([C@]5(C4)[C@](C(C)(C)[C@@H](O)CC5)(CC3)[H])CC[C@]1(C)[C@@]([C@@H](CCC=C(C)C)C)(CC2)[H])[H]
Synonyms:- (1R,3aS,3bS,5aR,7S,9aR,10aS,12aR)-3a,6,6,12a-Tetramethyl-1-[(2R)-6-methyl-5-hepten-2-yl]tetradecahydro-1H-cyclopenta[a]cyclopropa[e]phenanthren-7-ol
- (3β)-9,19-Cyclolanost-24-en-3-ol
- 1H,19H-Cyclopropa[9,10]cyclopenta[a]phenanthrene, 9,19-cyclolanost-24-en-3-ol deriv.
- 9,19-Cyclo-24-lanosten-3β-ol
- 9,19-Cyclo-9β-lanost-24-en-3β-ol
- 9,19-Cyclolanost-24-En-3-Ol, (3Beta,9Beta)-
- 9,19-Cyclolanost-24-en-3-ol, (3β)-
- Cycloart-24-en-3β-ol
- Cycloartenol
- Handianol
- NSC 670193
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Cycloartenol
CAS:Cycloartenol analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C30H50OPurity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:426.73(3β)-9,19-Cyclolanost-24-en-3-ol
CAS:Formula:C30H50OPurity:90%Color and Shape:SolidMolecular weight:426.7174Cycloartenol
CAS:Cycloartenol (Handianol) is a plant sterol compound widely found in plants and inhibits the migration of glioma cells.Formula:C30H50OPurity:98%Color and Shape:SolidMolecular weight:426.72Cycloartenol
CAS:Cyclic alcoholFormula:C30H50OPurity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:426.72Cycloartenol (>90%)
CAS:Controlled ProductApplications Cycloartenol is a triterpenoid used in eukaryotic steroid biosynthesis.
References Bode, H., et al.: Mol. Microbiol., 47, 471 (2003); Schwartz, H., et al.: J. Food Comp. Anal., 21, 152 (2007);Formula:C30H50OPurity:>90%Color and Shape:NeatMolecular weight:426.72Cycloartenol
CAS:Cycloartenol is a triterpenoid alcohol, which serves as a precursor in the biosynthesis of sterols. It is primarily derived from plant sources, as it plays a central role in the sterol synthesis pathway in higher plants. The mode of action of cycloartenol involves its conversion into various phytosterols through enzyme-catalyzed reactions, a process that is crucial for the formation of membrane lipids and signaling molecules in plants.Formula:C30H50OPurity:Min. 90 Area-%Color and Shape:White PowderMolecular weight:426.72 g/mol








