CAS 469-49-8
:(1′R,6′R)-7-Chloro-2′,4,6-trimethoxy-6′-methylspiro[benzofuran-2(3H),1′-[2]cyclohexene]-3,4′-dione
Description:
The chemical substance known as (1′R,6′R)-7-Chloro-2′,4,6-trimethoxy-6′-methylspiro[benzofuran-2(3H),1′-[2]cyclohexene]-3,4′-dione, with the CAS number 469-49-8, is a complex organic compound characterized by its unique spirocyclic structure. This compound features a benzofuran moiety fused with a cyclohexene ring, which contributes to its distinctive chemical properties. The presence of multiple methoxy groups enhances its solubility and reactivity, while the chlorine atom introduces additional polar characteristics. The stereochemistry indicated by the (1′R,6′R) configuration suggests specific spatial arrangements that can influence the compound's biological activity and interactions. Typically, such compounds may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The intricate structure and functional groups present in this compound can lead to diverse applications, including potential uses in drug development or as intermediates in organic synthesis. However, detailed studies are necessary to fully understand its reactivity, stability, and potential applications in various fields.
Formula:C17H17ClO6
InChI:InChI=1S/C17H17ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h6-8H,5H2,1-4H3/t8-,17-/m1/s1
InChI key:InChIKey=DDUHZTYCFQRHIY-CQLKUDPESA-N
SMILES:O=C1[C@]2(OC=3C1=C(OC)C=C(OC)C3Cl)C(OC)=CC(=O)C[C@H]2C
Synonyms:- (+)-Epigriseofulvin
- (1′R,6′R)-7-Chloro-2′,4,6-trimethoxy-6′-methylspiro[benzofuran-2(3H),1′-[2]cyclohexene]-3,4′-dione
- Spiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione,7-chloro-2',4,6-trimethoxy-6'-methyl-, (1'R-cis)-
- Spiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione,7-chloro-2',4,6-trimethoxy-6'a-methyl- (7CI,8CI)
- Spiro[benzofuran-2(3H),1′-[2]cyclohexene]-3,4′-dione, 7-chloro-2′,4,6-trimethoxy-6′-methyl-, (1′R,6′R)-
- Spiro[benzofuran-2(3H),1′-[2]cyclohexene]-3,4′-dione, 7-chloro-2′,4,6-trimethoxy-6′-methyl-, (1′R-cis)-
- Spiro[benzofuran-2(3H),1′-[2]cyclohexene]-3,4′-dione, 7-chloro-2′,4,6-trimethoxy-6′α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Epigriseofulvin
CAS:Controlled ProductStability Moisture Sensitive
Applications Epigriseofulvin has been used as a reactant for the syntheses of dl-griseofulvin, an antifungal agent.
References Takeuchi, Y., et. al.: Chem. Pharm. Bull., 45, 327, (1997); Taub, D., et. al.: Tetrahedron, 19, 1 (1963)Formula:C17H17ClO6Color and Shape:NeatMolecular weight:352.77

