CAS 469-54-5
:7-chloro-2'-hydroxy-4,6-dimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione
Description:
The chemical substance known as 7-chloro-2'-hydroxy-4,6-dimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione, with the CAS number 469-54-5, is a complex organic compound characterized by its unique spirocyclic structure. This compound features multiple functional groups, including a chloro group, hydroxyl group, and methoxy groups, which contribute to its chemical reactivity and potential biological activity. The presence of the benzofuran moiety and the cyclohexene ring indicates that it may exhibit interesting properties such as fluorescence or photochemical behavior. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The compound's solubility, stability, and reactivity can vary significantly based on environmental conditions and the presence of other chemical species. Overall, this substance represents a fascinating area of study within organic chemistry, particularly in the context of its synthesis and potential applications in various fields.
Formula:C16H15ClO6
InChI:InChI=1/C16H15ClO6/c1-7-4-8(18)5-11(19)16(7)15(20)12-9(21-2)6-10(22-3)13(17)14(12)23-16/h5-7,19H,4H2,1-3H3
SMILES:CC1CC(=O)C=C(C21C(=O)c1c(cc(c(c1O2)Cl)OC)OC)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Griseofulvic Acid
CAS:Controlled Product<p>Applications A newly metabolite of Griseofulvin (G787500).<br>References Oda, T., et al.: J. Antibiot., 59, 114 (2006), Rebacz, B., et al.: Cancer Res., 67, 6342 (2007), Uen, Y., et al.: J. Cell Biochem., 101, 1165 (2007),<br></p>Formula:C16H15ClO6Color and Shape:NeatMolecular weight:338.74Griseofulvic acid
CAS:<p>Griseofulvic acid is a molecule that encompasses an acidic chromatographic and plasma samples, urine metabolite, monocarboxylic acid, water molecule, pharmaceutical preparations, molecule, cancer and hyperproliferative. Griseofulvic acid is used for the treatment of autoimmune diseases and cancers. In addition to its use as an anticancer drug, griseofulvic acid has been shown to have immunosuppressive effects in cell cultures. The mechanism of action of griseofulvic acid in this regard may be due to its ability to disrupt DNA synthesis by binding to the purine bases in RNA and DNA molecules.</p>Formula:C16H15ClO6Purity:Min. 95%Molecular weight:338.74 g/molGriseofulvic Acid
CAS:Griseofulvic Acid ((±)-Griseofulvic acid) is a metabolite of the antifungal agent Griseofulvin. It induces protein aggregation and tubulin polymerization in cell-free assays.Formula:C16H15ClO6Molecular weight:338.74




