CAS 469-59-0
:Jervine
Description:
Jervine is a naturally occurring alkaloid primarily found in certain plant species, particularly in the family of plants known as the Liliaceae. It is classified as a steroidal alkaloid and is structurally related to other compounds such as veratramine and cyclopamine. Jervine is characterized by its complex steroid structure, which contributes to its biological activity. It exhibits a range of pharmacological effects, including potential neurotoxic properties, and has been studied for its impact on various physiological processes. The compound is known to interact with specific receptors in the nervous system, which can lead to both therapeutic and toxicological implications. Due to its biological activity, jervine has garnered interest in medicinal chemistry and pharmacology, although its use is limited due to safety concerns. As with many alkaloids, handling jervine requires caution due to its potential toxicity and the need for further research to fully understand its effects and applications.
Formula:C27H39NO3
InChI:InChI=1S/C27H39NO3/c1-14-11-21-24(28-13-14)16(3)27(31-21)10-8-19-20-6-5-17-12-18(29)7-9-26(17,4)23(20)25(30)22(19)15(27)2/h5,14,16,18-21,23-24,28-29H,6-13H2,1-4H3/t14-,16+,18-,19-,20-,21+,23+,24-,26-,27-/m0/s1
InChI key:InChIKey=CLEXYFLHGFJONT-DNMILWOZSA-N
SMILES:CC=1[C@@]2(O[C@]3([C@]([C@H]2C)(NC[C@@H](C)C3)[H])[H])CC[C@@]4(C1C(=O)[C@]5([C@]4(CC=C6[C@]5(C)CC[C@H](O)C6)[H])[H])[H]
Synonyms:- (2′R,3S,3′R,3′aS,6′S,6aS,6bS,7′aR,11aS,11bR)-2,3,3′a,4,4′,5′,6,6′,6a,6b,7,7′,7′a,8,11a,11b-Hexadecahydro-3-hydroxy-3′,6′,10,11b-tetramethylspiro[9H-benzo[a]fluorene-9,2′(3′H)-furo[3,2-b]pyridin]-11(1H)-one
- (3beta,22S,23R)-3-hydroxy-17,23-epoxyveratraman-11-one
- 17,23beta-Epoxy-3beta-hydroxyveratraman-11-one
- Brn 0059109
- Hsdb 3502
- Iervin
- Jervin
- Jerwiny
- Nsc 23898
- Nsc 7520
- Spiro(9H-benzo(a)fluorene-9,2'(3'H)-furo(3,2-b)-pyridin)-11(1H)-one, 2,3,3'a,4,4',5',6,6',6a,6b,7,7',7'a,8,11a,11b-hexadecahydro-3-hydroxy- 3',6',10,11b-tetramethyl-
- Spiro(9H-benzo(a)fluorene-9,2'(3'H)-furo(3,2-b)-pyridin)-11(1H)-one, 2,3,3'a,4,4',5',6,6',6a,6b,7,7',7'a,8,11a,11b-hexadecahydro-3-hydroxy-3',6',10, 11B-tetramethyl-
- Spiro[9H-benzo[a]fluorene-9,2′(3′H)-furo[3,2-b]pyridin]-11(1H)-one, 2,3,3′a,4,4′,5′,6,6′,6a,6b,7,7′,7′a,8,11a,11b-hexadecahydro-3-hydroxy-3′,6′,10,11b-tetramethyl-, (2′R,3S,3′R,3′aS,6′S,6aS,6bS,7′aR,11aS,11bR)-
- Spiro[9H-benzo[a]fluorene-9,2′(3′H)-furo[3,2-b]pyridin]-11(1H)-one, 2,3,3′a,4,4′,5′,6,6′,6a,6b,7,7′,7′a,8,11a,11b-hexadecahydro-3-hydroxy-3′,6′,10,11b-tetramethyl-, [3S-(3α,6aα,6bβ,9α(3′S*,3′aR*,6′R*,7′aS*),11aβ,11bα)]-
- Veratraman-11-one, 17,23-epoxy-3-hydroxy-, (3-beta,23-beta)-
- Veratraman-11-one, 17,23-epoxy-3-hydroxy-, (3beta,23beta)-
- Veratraman-11-one, 17,23-epoxy-3-hydroxy-, (3β,23β)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Jervine
CAS:Formula:C27H39NO3Purity:>97.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:425.61Jervine
CAS:Jervine exhibits cytotoxic activity against human tumor cell lines A549, PANC-1, SW1990 and NCI-H249, it induces COX-2 overexpression in human erythroleukemia cells. Jervine exhibits potent toxic effects against Colorado potato beetle.Formula:C27H39NO3Purity:95%~99%Molecular weight:425.613Jervine
CAS:Formula:C27H39NO3Purity:≥ 98.0%Color and Shape:White or off-white powderMolecular weight:425.60Jervine
CAS:Jervine inhibits Smoothened, blocking Hedgehog signaling and GLI1 transcription activation.Formula:C27H39NO3Purity:99.20% - 99.86%Color and Shape:Needles From Methanol + Water SolidMolecular weight:425.60Ref: TM-T3363
5mg66.00€10mg113.00€25mg245.00€50mg472.00€100mg677.00€500mg1,369.00€1mL*10mM (DMSO)71.00€Jervine
CAS:Natural alkaloidFormula:C27H39NO3Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:425.61Jervine
CAS:Jervine is a steroidal alkaloid, which is a naturally occurring compound derived from plants such as Veratrum californicum, commonly known as the corn lily. It possesses a unique mode of action by interfering with the Hedgehog (Hh) signaling pathway, which is crucial for regulating embryonic development and maintaining adult stem cells. Jervine achieves this by inhibiting the activity of the Smoothened (SMO) protein, a pivotal component of the Hh pathway, ultimately leading to the suppression of downstream signaling.Formula:C27H39NO3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:425.6 g/molJervine
CAS:M02030 - Jervine
Formula:C27H39NO3Purity:≥97%(HPLC)Color and Shape:SolidMolecular weight:425.613









