CAS 4694-17-1

5,5-dimethylcyclohex-2-en-1-one

Description:

5,5-Dimethylcyclohex-2-en-1-one, with the CAS number 4694-17-1, is an organic compound characterized by its cyclic structure featuring a cyclohexene ring with a ketone functional group. This compound has a double bond located at the 2-position of the cyclohexane ring and two methyl groups attached to the 5-position, contributing to its unique reactivity and physical properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the double bond and the carbonyl group makes it a reactive molecule, capable of undergoing various chemical reactions such as addition and oxidation. Its structure allows for potential applications in organic synthesis, particularly in the production of more complex molecules. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and the presence of catalysts. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if inhaled or ingested.

Formula: C₈H₁₂O

InChI: InChI=1/C8H12O/c1-8(2)5-3-4-7(9)6-8/h3-4H,5-6H2,1-2H3

Synonyms:

• 5,5-Dimethylcyclohex-2-enone
• 2-Cyclohexenone, 5,5-dimethyl-
• 2-Cyclohexen-1-one, 5,5-dimethyl-
• SKL128
• 5,5-dimethylcyclohex-2-en-1-one

5,5-Dimethylcyclohex-2-en-1-one

CAS: 4694-17-1

Formula: C₈H₁₂O

Purity: 95%

Molecular weight: 124.1803

Ref: IN-DA00DBGM

5,5-Dimethylcyclohex-2-en-1-one

CAS: 4694-17-1

5,5-Dimethylcyclohex-2-en-1-one

Purity: 95%

Molecular weight: 124.18g/mol

Ref: 54-OR85271

5,5-DIMETHYLCYCLOHEX-2-ENONE

CAS: 4694-17-1

Purity: 95%

Molecular weight: 124.1829987

Ref: 10-F858021

5,5-Dimethylcyclohex-2-en-1-one

CAS: 4694-17-1

5,5-Dimethylcyclohex-2-en-1-one is a heterocyclic compound with the molecular formula C8H14O. It is an organic compound that is a colorless liquid at room temperature. The compound has two methyl groups in the ring and one subtended methyl group. The dihedral angle between the two methyl groups is 107.9° and the conformation of this molecule can be described as boat shaped. The compound forms hydrogen bonds with water molecules due to its polar nature, which may account for its solubility in water. 5,5-Dimethylcyclohex-2-en-1-one has been used in the synthesis of pharmaceuticals and polymers, as well as other chemical compounds.

Formula: C₈H₁₂O

Purity: Min. 95%

Molecular weight: 124.18 g/mol

Ref: 3D-EAA69417