CAS 46947-87-9

4,4'-sulfonylbis(2-chlorophenol)

Description:

4,4'-Sulfonylbis(2-chlorophenol) is an organic compound characterized by its sulfonyl functional group and two chlorophenol moieties. It typically appears as a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of chlorine atoms on the phenolic rings enhances its reactivity and may influence its solubility in organic solvents. The sulfonyl group contributes to the compound's overall polarity and can participate in various chemical reactions, such as nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry. However, handling precautions are necessary due to potential toxicity associated with chlorinated compounds. Its stability under standard conditions is generally good, but it should be stored away from strong oxidizing agents and extreme temperatures to prevent degradation. As with any chemical substance, proper safety measures should be observed when working with 4,4'-sulfonylbis(2-chlorophenol) to mitigate any health or environmental risks.

Formula: C₁₂H₈Cl₂O₄S

InChI: InChI=1/C12H8Cl2O4S/c13-9-5-7(1-3-11(9)15)19(17,18)8-2-4-12(16)10(14)6-8/h1-6,15-16H

SMILES: c1cc(c(cc1S(=O)(=O)c1ccc(c(c1)Cl)O)Cl)O

Dichlorobisphenol S

CAS: 46947-87-9

Formula: C₁₂H₈Cl₂O₄S

Molecular weight: 319.15

Ref: 4Z-B-188003

Dichloro Bisphenol S Isomer

Controlled Product

CAS: 46947-87-9

Applications Dichloro Bisphenol S Isomer is an endocrine disruptor with estrogenic activity.
References Kuruto-Niwa, R., et al.: Environ. Toxicol. Pharmacol., 19, 121 (2005); Zheng, S., et al.: Water Res., 132, 167 (2018)

Formula: C₁₂H₈Cl₂O₄S

Color and Shape: Neat

Molecular weight: 319.16

Ref: TR-D432323