CAS 4695-90-3

N-benzyl-2-cyano-3-(4-hydroxyphenyl)prop-2-enamide

Description:

N-benzyl-2-cyano-3-(4-hydroxyphenyl)prop-2-enamide, with the CAS number 4695-90-3, is an organic compound characterized by its complex structure that includes a benzyl group, a cyano group, and a hydroxyphenyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in organic solvents. The presence of the cyano group suggests that it may participate in nucleophilic reactions, while the hydroxyphenyl group can engage in hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, the compound may display biological activity, making it of interest in medicinal chemistry and drug development. Its structural features allow for various functionalizations, which can be explored for applications in pharmaceuticals or as intermediates in organic synthesis. Overall, N-benzyl-2-cyano-3-(4-hydroxyphenyl)prop-2-enamide is a versatile compound with potential implications in various chemical and biological fields.

Formula: C₁₀H₁₀N₂

InChI: InChI=1/C17H14N2O2/c18-11-15(10-13-6-8-16(20)9-7-13)17(21)19-12-14-4-2-1-3-5-14/h1-10,20H,12H2,(H,19,21)

Synonyms:

• 5,6,7,8-Tetrahydro-isoquinoline-4-carbonitrile

5,6,7,8-Tetrahydroisoquinoline-4-carbonitrile

CAS: 4695-90-3

Versatile small molecule scaffold

Formula: C₁₇H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 278.3 g/mol

Ref: 3D-EAA69590