CAS 4696-76-8
:Kanamycin B
Description:
Kanamycin B is an aminoglycoside antibiotic that is primarily used to treat bacterial infections, particularly those caused by Gram-negative bacteria. It is derived from the bacterium *Micromonospora purpurea* and is known for its effectiveness against a variety of pathogens. The chemical structure of Kanamycin B features multiple amino groups, which contribute to its mechanism of action by inhibiting bacterial protein synthesis. This antibiotic is typically administered via injection or intravenously due to its poor absorption in the gastrointestinal tract. Kanamycin B is also characterized by its relatively low toxicity compared to other aminoglycosides, although it can still cause nephrotoxicity and ototoxicity, necessitating careful monitoring during treatment. Its use has declined in some regions due to the emergence of antibiotic resistance, but it remains a valuable option in specific clinical scenarios. As with all antibiotics, it is essential to use Kanamycin B judiciously to minimize the risk of resistance development.
Formula:C18H37N5O10
InChI:InChI=1S/C18H37N5O10/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18/h4-18,24-29H,1-3,19-23H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1
InChI key:InChIKey=SKKLOUVUUNMCJE-FQSMHNGLSA-N
SMILES:O([C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@@H]1N)[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N
Synonyms:- 2′-Amino-2′-deoxykanamycin
- 4,6-Diamino-3-[(3-Amino-3-Deoxyhexopyranosyl)Oxy]-2-Hydroxycyclohexyl 2,6-Diamino-2,6-Dideoxyhexopyranoside
- <span class="text-smallcaps">D</smallcap>-Streptamine, O-3-amino-3-deoxy-α-<smallcap>D</smallcap>-glucopyranosyl-(1→6)-O-[2,6-diamino-2,6-dideoxy-α-<smallcap>D</span>-glucopyranosyl-(1→4)]-2-deoxy-
- Aminodeoxykanamycin
- Beckanamycin
- Kanamycin B
- Kanendomycin
- Nebramycin V
- Nebramycin factor 5
- Nk 1006
- O-3-Amino-3-deoxy-α-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-(1→6)-O-[2,6-diamino-2,6-dideoxy-α-<smallcap>D</smallcap>-glucopyranosyl-(1→4)]-2-deoxy-<smallcap>D</span>-streptamine
- O-3-Amino-3-deoxy-α-D-glucopyranosyl-(1→6)-O-[2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl-(1→4)]-2-deoxy-D-streptamine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Bekanamycin
CAS:(2R,3S,4R,5R,6R)-5-Amino-2-(aminomethyl)-6-(((1R,2S,3S,4R,6S)-4,6-diamino-3-(((2S,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-2-hydroxycyclohexyl)oxy)tetrahydro-2H-pyran-3,4-diolFormula:C18H37N5O10Purity:98%Molecular weight:483.51Kanamycin B
CAS:Formula:C18H37N5O10Purity:≥ 90.0%Color and Shape:White to off-white crystalline powderMolecular weight:483.51Bekanamycin
CAS:Bekanamycin (Kanamycin B) is an aminoglycoside antibiotic, which inhibits a range of Gram-positive and Gram-negative bacteria. High-Quality, Low-Cost!Formula:C18H37N5O10Purity:99.08% - 99.97%Color and Shape:SolidMolecular weight:483.51Kanamycin B
CAS:Applications Kanamycin B (cas# 4696-76-8) is a compound useful in organic synthesis.
Formula:C18H37N5O10Color and Shape:NeatMolecular weight:483.51Kanamycin B
CAS:Kanamycin B is a broad spectrum antibiotic active against both gram-positive and gram-negative bacteria, often used to treat eye infections. Compared to Kanamycin A, it exhibits stronger interaction with the acidic phospholipids.
Formula:C18H37N5O10Purity:Min. 95%Color and Shape:PowderMolecular weight:483.51 g/mol









