CymitQuimica logo

CAS 4697-83-0

:

(9alpha,11alpha)-sparteine-2,17-dione

Description:
(9alpha,11alpha)-Sparteine-2,17-dione, with the CAS number 4697-83-0, is a chemical compound that belongs to the class of alkaloids derived from the plant species of the genus Lupinus. This compound is characterized by its unique bicyclic structure, which includes a quinolizidine framework. It typically exhibits a range of biological activities, including potential effects on the central nervous system and interactions with various receptors. The compound is known for its chiral nature, which can influence its pharmacological properties. In terms of physical properties, it may be a solid at room temperature and is likely to be soluble in organic solvents. Its reactivity can be attributed to the presence of carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions. Overall, (9alpha,11alpha)-sparteine-2,17-dione is of interest in both synthetic organic chemistry and pharmacology due to its structural features and biological significance.
Formula:C15H22N2O2
InChI:InChI=1/C15H22N2O2/c18-14-6-3-5-13-11-8-10(9-17(13)14)12-4-1-2-7-16(12)15(11)19/h10-13H,1-9H2/t10-,11-,12+,13+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.