CAS 46995-88-4

3-methoxy-4-(2-piperidin-1-ylethoxy)benzaldehyde

Description:

3-Methoxy-4-(2-piperidin-1-ylethoxy)benzaldehyde, with the CAS number 46995-88-4, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a piperidine-derived side chain. This compound features a benzaldehyde functional group, indicating it has an aldehyde (-CHO) moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions. The piperidine ring adds to its structural complexity and may impart specific biological activities, making it of interest in medicinal chemistry. Overall, this compound's unique combination of functional groups suggests potential utility in the development of pharmaceuticals or as an intermediate in organic synthesis, although specific biological or chemical properties would require further investigation through empirical studies.

Formula: C₁₅H₂₁NO₃

InChI: InChI=1/C15H21NO3/c1-18-15-11-13(12-17)5-6-14(15)19-10-9-16-7-3-2-4-8-16/h5-6,11-12H,2-4,7-10H2,1H3

SMILES: COc1cc(ccc1OCCN1CCCCC1)C=O

Synonyms:

• 3-Methoxy-4-[2-(piperidin-1-yl)ethoxy]benzaldehyde
• Benzaldehyde, 3-methoxy-4-[2-(1-piperidinyl)ethoxy]-

3-Methoxy-4-(2-piperidin-1-yl-ethoxy)-benzaldehyde

CAS: 46995-88-4

Versatile small molecule scaffold

Formula: C₁₅H₂₁NO₃

Purity: Min. 95%

Molecular weight: 263.33 g/mol

Ref: 3D-WBA99588