CAS 470-12-2
:2,6-Dideoxy-3-C-methyl-3-O-methyl-ribo-hexose
Description:
2,6-Dideoxy-3-C-methyl-3-O-methyl-ribo-hexose, with the CAS number 470-12-2, is a carbohydrate derivative characterized by its unique structural features. This compound is a hexose sugar, specifically a modified ribose, which includes two deoxy groups at the 2 and 6 positions, indicating the absence of hydroxyl groups at these sites. Additionally, it possesses a methyl group at the 3 position and a methoxy group (–OCH3) also at the 3 position, contributing to its chemical reactivity and solubility properties. The presence of these modifications affects its biological activity and potential applications in pharmaceuticals and biochemistry. This compound may exhibit specific interactions with enzymes or receptors due to its structural uniqueness, making it of interest in research related to glycosylation and carbohydrate metabolism. Its stability, solubility in various solvents, and reactivity with other chemical species can vary based on environmental conditions, such as pH and temperature. Overall, 2,6-Dideoxy-3-C-methyl-3-O-methyl-ribo-hexose represents a fascinating example of modified sugars with potential implications in various scientific fields.
Formula:C8H16O4
InChI:InChI=1/C8H16O4/c1-6(10)7(11)8(2,12-3)4-5-9/h5-7,10-11H,4H2,1-3H3/t6-,7-,8+/s2
InChI key:InChIKey=AJSDVNKVGFVAQU-FUTZBWQWNA-N
SMILES:[C@]([C@@H]([C@@H](C)O)O)(CC=O)(OC)C
Synonyms:- Cladinose
- 2,6-Dideoxy-3-C-methyl-3-O-methyl-ribo-hexose
- ribo-Hexose, 2,6-dideoxy-3-C-methyl-3-O-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cladinose
CAS:Controlled ProductApplications A hexose sugar commonly associated with the macrolide ring of relevant antibiotics.
References Darrington, R., et al.: J. Pharm. Sci., 93, 838 (2004), Randolph, J., et al.: J. Med. Chem., 47, 1085 (2004), Butler, M., et al.: Environ. Sci. Technol., 39, 2301 (2005), Vazquez-Laslop, N., et al.: Mol. Cell., 30, 190 (2008),Formula:C8H16O4Color and Shape:NeatMolecular weight:176.21Cladinose
CAS:Cladinose is a natural compound that has been shown to have potent inhibitory properties against microorganisms, such as bacteria and fungi. Cladinose has been shown to inhibit the growth of bacteria by reacting with the ribosomes of cells in the bacterial cytoplasm. It inhibits bacterial protein synthesis by binding to the ribosomal RNA and blocking access to the mRNA template. Cladinose also inhibits fungal growth by inhibiting ergosterol biosynthesis, which prevents fungal cell membrane formation. Cladinose has been shown to have antiinflammatory activity in mice with induced inflammation. This is due to its ability to bind to cyclooxygenase-2 (COX-2) and prevent its activation, thereby preventing prostaglandin synthesis.Formula:C8H16O4Purity:Min. 95%Molecular weight:176.21 g/mol



