CAS 470-29-1
:2,4-Dihydroxy-3,3-dimethylbutanoic acid
Description:
2,4-Dihydroxy-3,3-dimethylbutanoic acid, with the CAS number 470-29-1, is an organic compound characterized by its hydroxyl and carboxylic acid functional groups. This compound features two hydroxyl (-OH) groups located at the 2 and 4 positions of a butanoic acid backbone, which contributes to its solubility in water and its potential reactivity. The presence of two methyl groups at the 3 position enhances its steric bulk, influencing its chemical behavior and interactions. This compound is typically a white crystalline solid at room temperature and is known for its role in various biochemical pathways, particularly in the context of metabolic processes. Its structural features suggest potential applications in pharmaceuticals and biochemistry, where it may act as an intermediate or a building block for more complex molecules. Additionally, the presence of multiple functional groups allows for diverse reactivity, making it a subject of interest in synthetic organic chemistry.
Formula:C6H12O4
InChI:InChI=1S/C6H12O4/c1-6(2,3-7)4(8)5(9)10/h4,7-8H,3H2,1-2H3,(H,9,10)
InChI key:InChIKey=OTOIIPJYVQJATP-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)O)(CO)(C)C
Synonyms:- (R)-2,4-Dihydroxy-3,3-dimethylbutanoic acid
- (RS)-Pantoic acid
- 2,4-Dihydroxy-2,3-dimethylbutyric acid
- 2,4-Dihydroxy-3,3-dimethylbutanoic acid
- Butanoic acid, 2,4-dihydroxy-3,3-dimethyl-
- Butyric acid, 2,4-dihydroxy-3,3-dimethyl-
- Butyric acid, α,γ-dihydroxy-β,β-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(RS)-Pantoic Acid Sodium Salt Monohydrate
CAS:Controlled ProductFormula:C6H11NaO4Color and Shape:NeatMolecular weight:170.1392,4-Dihydroxy-3,3-dimethylbutanoic acid
CAS:<p>2,4-Dihydroxy-3,3-dimethylbutanoic acid is a synthetic organic compound that belongs to the group of medicinal drugs. It is used in the synthesis of pantolactone, which is an intermediate for the production of synthetic cortisone. 2,4-Dihydroxy-3,3-dimethylbutanoic acid has been shown to be an intermediate in the biosynthesis of corynebacterium glutamicum and porcine pancreatic lipase. This compound is also a substrate for pancreatic lipase in acidic solutions and in the reaction solution.</p>Formula:C6H12O4Purity:Min. 95%Molecular weight:148.16 g/mol


