CAS 4702-34-5
:3,4-Dihydroisocoumarin
Description:
3,4-Dihydroisocoumarin is a bicyclic organic compound characterized by its fused isocoumarin structure, which features a lactone ring. It is a colorless to pale yellow liquid or solid, depending on its purity and form. This compound is known for its aromatic properties and is often used in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its molecular formula typically includes carbon, hydrogen, and oxygen atoms, contributing to its reactivity and potential applications in chemical reactions, such as cyclization and functionalization. 3,4-Dihydroisocoumarin exhibits moderate solubility in organic solvents, making it useful in various chemical processes. Additionally, it may possess biological activity, which has led to interest in its potential therapeutic applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H8O2
InChI:InChI=1S/C9H8O2/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-4H,5-6H2
InChI key:InChIKey=XVTAQSGZOGYIEY-UHFFFAOYSA-N
SMILES:O=C1C=2C(CCO1)=CC=CC2
Synonyms:- 1-Isochromanone
- 1H-2-Benzopyran-1-one, 3,4-dihydro-
- 3,4-Dihydroisochromen-1-one
- 3,4-Dihydroisocoumarin
- 3,4-dihydro-1H-isochromen-1-one
- Dihydroisocoumarin
- Isochroman-1-One
- Isocoumarin, 3,4-dihydro-
- 3,4-Dihydro-1H-2-benzopyran-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Isochromanone
CAS:Formula:C9H8O2Purity:>98.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:148.16Isochroman-1-one
CAS:Isochroman-1-oneFormula:C9H8O2Purity:98%Color and Shape: clear. faint yellow liquidMolecular weight:148.16g/molIsochroman-1-one
CAS:Isochroman-1-one is a natural compound that is found in copper chloride acetate extracts of plants. It has been shown to have inhibitory effects on the growth of endophytes and on the fatty acid metabolism of plants. Isochroman-1-one also has antimicrobial activity against human serum and cervical cancer cells. It inhibits the activity of matrix metalloproteinases (MMPs) such as MMP-9, which are enzymes that degrade extracellular matrix proteins in the body. Isochroman-1-one is synthesized from etoac extract, which is obtained from a plant called Eucalyptus tereticornis. The synthesis involves an asymmetric process with a hydroxyl group as one of the reagents.
Formula:C9H8O2Purity:Min. 95%Molecular weight:148.16 g/mol




