CAS 470441-67-9

1-(Pyridin-3-yl)piperazine dihydrochloride

Description:

1-(Pyridin-3-yl)piperazine dihydrochloride is a chemical compound characterized by its piperazine core substituted with a pyridine ring at the 3-position. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of two hydrochloride groups, which enhance its solubility and stability. It is often utilized in pharmaceutical research and development, particularly in the synthesis of potential therapeutic agents, owing to its ability to interact with various biological targets. The dihydrochloride form indicates that the compound has two hydrochloride ions associated with it, which can influence its pharmacokinetic properties. Additionally, the presence of the pyridine moiety may contribute to its biological activity, making it a subject of interest in medicinal chemistry. As with many piperazine derivatives, it may exhibit a range of pharmacological effects, including anxiolytic, antidepressant, or antipsychotic properties, depending on its specific interactions with neurotransmitter systems. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₉H₁₅Cl₂N₃

InChI: InChI=1/C9H13N3.2ClH/c1-2-9(8-11-3-1)12-6-4-10-5-7-12;;/h1-3,8,10H,4-7H2;2*1H

SMILES: c1cc(cnc1)N1CCNCC1.Cl.Cl

Synonyms:

• Piperazine, 1-(3-Pyridinyl)-, Hydrochloride (1:2)

1-PYRIDIN-3-YL-PIPERAZINE DIHYDROCHLORIDE

CAS: 470441-67-9

Formula: C₉H₁₅Cl₂N₃

Purity: 95%

Molecular weight: 236.1415

Ref: IN-DA00DJRD

Ribociclib Impurity 44 DiHCl

CAS: 470441-67-9

Formula: C₉H₁₃N₃·2HCl

Molecular weight: 163.22 2*36.46

Ref: 4Z-R-128060

1-(Pyridin-3-yl)piperazine dihydrochloride

CAS: 470441-67-9

Formula: C₉H₁₅Cl₂N₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 236.14

Ref: 10-F431329