CymitQuimica logo

CAS 470462-56-7

:

2-[2-[bis(2-hydroxy-2-oxo-ethyl)amino]ethyl-(2-hydroxy-2-oxo-ethyl)amino]acetic acid

Description:
The chemical substance known as 2-[2-[bis(2-hydroxy-2-oxo-ethyl)amino]ethyl-(2-hydroxy-2-oxo-ethyl)amino]acetic acid, with CAS number 470462-56-7, is a complex organic compound characterized by its multifunctional structure. It features multiple hydroxyl and amino groups, which contribute to its solubility in water and potential for forming hydrogen bonds. The presence of the acetic acid moiety suggests that it can act as a weak acid, capable of donating protons in solution. This compound is likely to exhibit chelating properties due to the presence of multiple functional groups that can coordinate with metal ions. Its structure indicates potential applications in biochemistry and pharmaceuticals, particularly in drug formulation or as a biochemical reagent. Additionally, the presence of hydroxy and keto groups may impart biological activity, making it of interest in medicinal chemistry. Overall, this compound's unique characteristics stem from its intricate arrangement of functional groups, which influence its chemical behavior and potential applications.
Formula:C613C4H16N2O8
InChI:InChI=1/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/i7+1,8+1,9+1,10+1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.