CAS 4707-33-9: 3,4-Dihydro-2,2-dimethyl-2H-naphtho[2,3-b]pyran-5,10-dione
Description:3,4-Dihydro-2,2-dimethyl-2H-naphtho[2,3-b]pyran-5,10-dione, with the CAS number 4707-33-9, is a chemical compound characterized by its unique bicyclic structure that incorporates both naphthalene and pyran moieties. This compound features a diketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of two methyl groups at the 2-position enhances its steric properties and may influence its solubility and stability. Typically, compounds of this nature exhibit interesting photophysical properties, making them of interest in fields such as materials science and organic electronics. Additionally, the diketone structure may allow for various chemical transformations, including reduction and condensation reactions. While specific biological activities may vary, compounds with similar structures have been studied for their potential pharmacological properties. Overall, 3,4-Dihydro-2,2-dimethyl-2H-naphtho[2,3-b]pyran-5,10-dione represents a versatile scaffold for further chemical exploration and application.
Formula:C15H14O3
InChI:InChI=1S/C15H14O3/c1-15(2)8-7-11-12(16)9-5-3-4-6-10(9)13(17)14(11)18-15/h3-6H,7-8H2,1-2H3
InChI key:InChIKey=PJWHOPKRRBUSDH-UHFFFAOYSA-N
SMILES:O=C1C=2OC(C)(C)CCC2C(=O)C=3C=CC=CC13
- Synonyms:
- 2,2-Dimethyl-3,4-dihydrobenzo[g]chromene-5,10-dione
- 2H-naphtho[2,3-b]pyran-5,10-dione, 3,4-dihydro-2,2-dimethyl-
- 3,4-Dihydro-2,2-dimethyl-2H-naphtho[2,3-b]pyran-5,10-dione
- NSC 26327
- NSC 629747
- α-Lapachone
![3,4-Dihydro-2,2-dimethyl-2H-naphtho[2,3-b]pyran-5,10-dione](https://static.cymitquimica.com/cas-image/429173-34-dihydro-22-dimethyl-2h-naphtho-23-b-pyran-510-dione.png)
