CAS 4707-50-0
:2,4-Dihydroxy-6-propylbenzoic acid
Description:
2,4-Dihydroxy-6-propylbenzoic acid, with the CAS number 4707-50-0, is an organic compound characterized by its aromatic structure featuring a benzoic acid core substituted with two hydroxyl groups and a propyl group. This compound typically exhibits properties associated with phenolic acids, including moderate solubility in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The presence of the propyl group influences its hydrophobic characteristics, potentially affecting its biological activity and interactions. As a dihydroxybenzoic acid derivative, it may exhibit antioxidant properties and could be of interest in various applications, including pharmaceuticals and agrochemicals. Its structural features suggest potential for reactivity in esterification or other organic transformations. Additionally, the compound's stability and behavior in different environments can be influenced by pH and temperature, making it relevant in both synthetic and natural processes. Overall, 2,4-Dihydroxy-6-propylbenzoic acid is a compound of interest in both research and industrial contexts due to its unique chemical properties.
Formula:C10H12O4
InChI:InChI=1S/C10H12O4/c1-2-3-6-4-7(11)5-8(12)9(6)10(13)14/h4-5,11-12H,2-3H2,1H3,(H,13,14)
InChI key:InChIKey=RIVVNGIVVYEIRS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(CCC)C=C(O)C=C1O
Synonyms:- Benzoic acid, 2,4-dihydroxy-6-propyl-
- Divaric acid
- Divarinolic acid
- β-Resorcylic acid, 6-propyl-
- 2,4-Dihydroxy-6-propylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Varinolic Acid
CAS:Varinolic acid, an analytical reference standard, plays a crucial role as an intermediate in the phytocannabinoid biosynthetic pathway. It serves as a precursor for synthesizing cannabidivarin (CBDV), cannabigerovarin (CBGV), and cannabivarin (CBV). This compound is designed for research and forensic applications.Formula:C10H12O4Color and Shape:SolidMolecular weight:196.19992,4-Dihydroxy-6-propylbenzoic acid
CAS:2,4-Dihydroxy-6-propylbenzoic acid is an intermediate in the biosynthesis of the cannabinoids cannabigerol (CBG) and cannabigerovarinic acid (CBGV). It is a substrate for cyclooxygenase-1 (COX-1), which converts it to 2,4-dihydroxybenzoic acid. CBG and CBGV inhibit the growth of bacteria by binding to cannabinoid receptors on the cell surface. These cannabinoids also have been shown to have antiinflammatory properties. 2,4-Dihydroxy-6-propylbenzoic acid has been shown in clinical studies to be effective against infectious diseases such as malaria, leishmaniasis, and tuberculosis.
Formula:C10H12O4Purity:Min. 95%Color and Shape:Slightly Brown PowderMolecular weight:196.2 g/mol



