CAS 47072-52-6
:2-[6-(2,2-dicyanovinyl)-3,4-dihydro-2H-quinolin-1-yl]acetic acid
Description:
2-[6-(2,2-Dicyanovinyl)-3,4-dihydro-2H-quinolin-1-yl]acetic acid, with CAS number 47072-52-6, is a chemical compound characterized by its unique structure that includes a quinoline moiety and a dicyanovinyl group. This compound typically exhibits properties associated with both organic acids and nitrogen-containing heterocycles. It is likely to be a solid at room temperature, with potential applications in organic synthesis, pharmaceuticals, or as a dye due to its conjugated system, which may impart interesting optical properties. The presence of the dicyanovinyl group suggests that it may have significant electron-withdrawing characteristics, influencing its reactivity and interactions with other chemical species. Additionally, the carboxylic acid functional group in its structure indicates that it can participate in acid-base reactions and may form salts or esters. Overall, this compound's unique structural features contribute to its potential utility in various chemical applications, although specific reactivity and stability would depend on the surrounding conditions and environment.
Formula:C15H13N3O2
InChI:InChI=1/C15H13N3O2/c16-8-12(9-17)6-11-3-4-14-13(7-11)2-1-5-18(14)10-15(19)20/h3-4,6-7H,1-2,5,10H2,(H,19,20)
SMILES:C1Cc2cc(ccc2N(C1)CC(=O)O)C=C(C#N)C#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Carboxymethyl-6-(2,2-dicyanovinyl)-1,2,3,4-tetrahydroquinoline
CAS:Formula:C15H13N3O2Molecular weight:267.28
