CAS 4708-96-7
:4-(dimethylamino)-3,10,12,12a-tetrahydroxy-7-(methylamino)-1,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide
Description:
The chemical substance known as 4-(dimethylamino)-3,10,12,12a-tetrahydroxy-7-(methylamino)-1,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide, with CAS number 4708-96-7, is a complex organic compound characterized by its tetracene backbone, which is a polycyclic aromatic hydrocarbon. This compound features multiple hydroxyl groups and amine substituents, contributing to its potential solubility in polar solvents and its reactivity. The presence of dioxo groups indicates that it may exhibit significant oxidative properties. Its structure suggests potential applications in fields such as organic electronics, dyes, or pharmaceuticals, particularly due to the presence of functional groups that can participate in various chemical reactions. Additionally, the dimethylamino and methylamino groups may enhance its electronic properties, making it of interest in studies related to charge transport or photonic applications. However, specific safety and handling information should be consulted, as compounds with such complex structures can exhibit varied biological activities and toxicity profiles.
Formula:C22H25N3O7
InChI:InChI=1/C22H25N3O7/c1-24-11-4-5-12(26)14-9(11)6-8-7-10-16(25(2)3)18(28)15(21(23)31)20(30)22(10,32)19(29)13(8)17(14)27/h4-5,8,10,16,24,26,28-29,32H,6-7H2,1-3H3,(H2,23,31)
SMILES:CNc1ccc(c2c1CC1CC3C(C(=C(C(=O)C3(C(=C1C2=O)O)O)C(=N)O)O)N(C)C)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Minocycline hydrochloride dihydrate EP Impurity C
CAS:Impurity C is a minor impurity of Minocycline Hydrochloride Dihydrate. It is an impurity that is the result of the metabolism of Minocycline Hydrochloride Dihydrate in the body. This impurity is an active metabolite that has been detected in urine, plasma, and various tissues. Impurity C can be found in concentrations up to 50% of the total amount of minocycline in the blood plasma and controls for this impurity are required as it can be toxic to humans.Formula:C22H25N3O7Purity:Min. 95%Molecular weight:443.45 g/mol
