CAS 471-05-6: Zerumbone
Description:Zerumbone is a naturally occurring sesquiterpene compound primarily derived from the essential oil of the Zingiber zerumbet plant, commonly known as the shampoo ginger. It is characterized by its unique chemical structure, which includes a bicyclic framework. Zerumbone is known for its potential biological activities, including anti-inflammatory, antioxidant, and anticancer properties, making it a subject of interest in pharmacological research. The compound is typically a colorless to pale yellow liquid with a pleasant, aromatic odor. Its solubility profile indicates that it is soluble in organic solvents but has limited solubility in water. Zerumbone has been studied for its effects on various cellular pathways and its potential therapeutic applications, particularly in the context of cancer treatment and prevention. Additionally, its safety profile has been evaluated, showing low toxicity in various studies. Overall, zerumbone represents a promising natural product with diverse applications in health and wellness.
Formula:C15H22O
InChI:InChI=1/C15H22O/c1-12-6-5-7-13(2)14(16)9-11-15(3,4)10-8-12/h7-9,11H,5-6,10H2,1-4H3/b11-9+,12-8+,13-7+
InChI key:InChIKey=GIHNTRQPEMKFKO-SKTNYSRSSA-N
SMILES:O=C1C=CC(C)(C)CC=C(C)CCC=C1C
- Synonyms:
- (2E,6E,10E)-2,6,9,9-Tetramethyl-2,6,10-cycloundecatrien-1-one
- 2,6,10-Cycloundecatrien-1-one, 2,6,9,9-tetramethyl-, (E,E,E)-
- 2,6,10-cycloundecatrien-1-one, 2,6,9,9-tetramethyl-, (2E,6E,10E)-
- Z 3902
- Zerumbone
- (2E,6E,10E)-2,6,9,9-Tetramethylcycloundeca-2,6,10-trien-1-one
