
CAS 471-31-8
:Hydrazinecarboxylic acid
Description:
Hydrazinecarboxylic acid, with the CAS number 471-31-8, is an organic compound characterized by the presence of both hydrazine and carboxylic acid functional groups. It typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. This compound is known for its reactivity, particularly due to the hydrazine moiety, which can participate in various chemical reactions, including oxidation and condensation. Hydrazinecarboxylic acid is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Its properties include moderate solubility in water and organic solvents, and it may exhibit basic characteristics due to the presence of the hydrazine group. Safety precautions are essential when handling this compound, as it can be toxic and potentially hazardous. Overall, hydrazinecarboxylic acid is a versatile compound with applications in various chemical processes, but it requires careful handling due to its reactive nature.
Formula:CH4N2O2
InChI:InChI=1S/CH4N2O2/c2-3-1(4)5/h3H,2H2,(H,4,5)
InChI key:InChIKey=OWIUPIRUAQMTTK-UHFFFAOYSA-N
SMILES:C(NN)(=O)O
Synonyms:- Carbonic acid, monohydrazide
- Carbazic acid
- Hydrazinecarboxylic acid
- Formic acid, hydrazino-
- Carbazinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
