CAS 471-66-9: alpha-Boswellic acid
Description:Alpha-Boswellic acid is a pentacyclic triterpenoid compound primarily derived from the resin of the Boswellia serrata tree, commonly known as Indian frankincense. It is characterized by its white to off-white crystalline appearance and is known for its various biological activities. Alpha-Boswellic acid exhibits anti-inflammatory, analgesic, and anti-cancer properties, making it of interest in both traditional medicine and modern pharmacology. The compound functions by inhibiting pro-inflammatory mediators and enzymes, such as 5-lipoxygenase, which plays a role in the inflammatory response. Additionally, it has been studied for its potential to enhance the bioavailability of other therapeutic agents. The substance is soluble in organic solvents but has limited solubility in water, which can affect its bioavailability in biological systems. Its safety profile is generally favorable, although further research is necessary to fully understand its pharmacokinetics and long-term effects. Overall, alpha-Boswellic acid represents a significant area of interest for its therapeutic potential in various health conditions.
Formula:C30H48O3
InChI:InChI=1S/C30H48O3/c1-25(2)14-15-26(3)16-17-28(5)19(20(26)18-25)8-9-21-27(4)12-11-23(31)30(7,24(32)33)22(27)10-13-29(21,28)6/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21+,22+,23+,26+,27+,28+,29+,30+/m0/s1
InChI key:InChIKey=BZXULBWGROURAF-IKNLXHIFSA-N
SMILES:O=C(O)C1(C)C(O)CCC2(C)C3CC=C4C5CC(C)(C)CCC5(C)CCC4(C)C3(C)CCC12
- Synonyms:
- (3α,4β)-3-Hydroxyolean-12-en-23-oic acid
- 3α-Acetyl-α-boswellic acid
- Alpha-Boswellic Acid
- Olean-12-En-24-Oic Acid, 3-Hydroxy-, (3Alpha)-
- Olean-12-en-23-oic acid, 3-hydroxy-, (3α,4β)-
- Olean-12-en-24-oic acid, 3α-hydroxy-
- α-Boswellic acid
- (3alpha)-3-Hydroxyolean-12-en-24-oic acid
