CAS 471-74-9
:(-)-Sandaracopimaric acid
Description:
(-)-Sandaracopimaric acid is a naturally occurring diterpenoid compound primarily derived from various coniferous trees. It is characterized by its complex bicyclic structure, which includes a fused ring system typical of many resin acids. This compound exhibits a range of biological activities, including anti-inflammatory and antimicrobial properties, making it of interest in both pharmacological and industrial applications. (-)-Sandaracopimaric acid is typically found in the form of a solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. Its chemical behavior is influenced by the presence of functional groups, including carboxylic acid, which contributes to its reactivity and potential for forming esters and other derivatives. The compound is also notable for its role in the production of natural resins and as a precursor in the synthesis of various chemical entities. Overall, (-)-Sandaracopimaric acid is a significant compound in the study of natural products and their applications in medicine and industry.
Formula:C20H30O2
InChI:InChI=1S/C20H30O2/c1-5-18(2)12-9-15-14(13-18)7-8-16-19(15,3)10-6-11-20(16,4)17(21)22/h5,13,15-16H,1,6-12H2,2-4H3,(H,21,22)/t15-,16+,18-,19+,20+/m0/s1
InChI key:InChIKey=MHVJRKBZMUDEEV-KRFUXDQASA-N
SMILES:C[C@@]12[C@]([C@@](C(O)=O)(C)CCC1)(CCC=3[C@@]2(CC[C@@](C=C)(C)C3)[H])[H]
Synonyms:- (-)-Sandaracopimaric acid
- (1R,4aR,4bS,7R,10aR)-7-Ethenyl-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,4a,7-trimethyl-1-phenanthrenecarboxylic acid
- 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7R,10aR)-
- 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,4a,7-trimethyl-, [1R-(1α,4aβ,4bα,7α,10aα)]-
- 13beta-Methyl-13-vinylpodocarp-8(14)-en-15-oic acid
- 7-Epipimara-8(14),18-dienoic acid
- Cryptopimaric acid
- Isodextropimaric acid
- NSC 6435
- Podocarp-8(14)-en-15-oic acid, 13β-methyl-13-vinyl-
- Sandarakopimaric acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Sandaracopimaric acid
CAS:Sandaracopimaric acid, an anti-inflammatory diterpene, relaxes pulmonary arteries with an EC50 of 43.93 μM.Formula:C20H30O2Color and Shape:SolidMolecular weight:302.45(-)-Sandaracopimaric Acid
CAS:Controlled ProductFormula:C20H30O2Color and Shape:NeatMolecular weight:302.451Sandaracopimaric acid
CAS:Sandaracopimaric acid is a naturally occurring resin acid, which is typically derived from the resin of coniferous trees, particularly those belonging to the genera *Agathis* and *Callitris*. This compound is a diterpenoid, which forms part of the complex matrix of resin acids secreted by these trees. The mode of action of Sandaracopimaric acid involves potential anti-inflammatory and antioxidative effects, attributed to its ability to modulate inflammatory pathways and scavenge free radicals.
Formula:C20H30O2Purity:Min. 95%Molecular weight:302.45 g/mol



