CAS 4710-75-2

1-(3,5-di-O-tritylpentofuranosyl)pyrimidine-2,4(1H,3H)-dione

Description:

1-(3,5-di-O-tritylpentofuranosyl)pyrimidine-2,4(1H,3H)-dione, with CAS number 4710-75-2, is a chemical compound characterized by its unique structural features that combine a pyrimidine ring with a pentofuranosyl moiety. The presence of two trityl groups (3,5-di-O-trityl) enhances its stability and solubility, making it suitable for various applications in organic synthesis and medicinal chemistry. This compound exhibits properties typical of pyrimidine derivatives, including potential biological activity, which may involve interactions with nucleic acids or enzymes. The furanosyl sugar component contributes to its ability to mimic nucleosides, potentially influencing its reactivity and biological interactions. Additionally, the compound's stability under various conditions can be attributed to the protective trityl groups, which can be selectively removed in synthetic processes. Overall, this compound represents a valuable intermediate in the synthesis of nucleoside analogs and other biologically relevant molecules.

Formula: C₄₇H₄₀N₂O₆

InChI: InChI=1/C47H40N2O6/c50-41-31-32-49(45(52)48-41)44-42(51)43(55-47(37-25-13-4-14-26-37,38-27-15-5-16-28-38)39-29-17-6-18-30-39)40(54-44)33-53-46(34-19-7-1-8-20-34,35-21-9-2-10-22-35)36-23-11-3-12-24-36/h1-32,40,42-44,51H,33H2,(H,48,50,52)

SMILES: c1ccc(cc1)C(c1ccccc1)(c1ccccc1)OCC1C(C(C(n2ccc(nc2=O)O)O1)O)OC(c1ccccc1)(c1ccccc1)c1ccccc1

3',5'-Bis-O-(triphenylmethyl)uridine

CAS: 4710-75-2

3',5'-Bis-O-(triphenylmethyl)uridine is a Nucleoside Derivative - Protected nucleoside with NH2/OH group.

Formula: C₄₇H₄₀N₂O₆

Color and Shape: Solid

Molecular weight: 728.83

Ref: TM-TNU0876

3',5'-Bis-O-(triphenylmethyl)uridine

CAS: 4710-75-2

3',5'-Bis-O-(triphenylmethyl)uridine is a partially protected uridine analogue

Formula: C₄₇H₄₀N₂O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 728.83 g/mol

Ref: 3D-NB144785