
CAS 4711-06-2
:(1R,2R,3R)-1-quinoxalin-2-ylbutane-1,2,3,4-tetrol
Description:
The chemical substance known as (1R,2R,3R)-1-quinoxalin-2-ylbutane-1,2,3,4-tetrol, with the CAS number 4711-06-2, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a quinoxaline moiety, which is a bicyclic structure containing two nitrogen atoms, contributing to its potential biological activity. The presence of multiple hydroxyl (-OH) groups indicates that it is a polyol, which can influence its solubility and reactivity. The stereochemistry denoted by (1R,2R,3R) suggests that the compound has specific three-dimensional orientations that may affect its interactions with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features. Additionally, its synthesis and characterization would involve techniques such as NMR spectroscopy and mass spectrometry to confirm its identity and purity. Overall, this compound's unique structure and functional groups make it a subject of interest in various chemical and biological research fields.
Formula:C12H14N2O4
InChI:InChI=1/C12H14N2O4/c15-6-10(16)12(18)11(17)9-5-13-7-3-1-2-4-8(7)14-9/h1-5,10-12,15-18H,6H2/t10-,11-,12+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R,2S,3R)-1-(2-Quinoxalinyl)-1,2,3,4-butanetetrol
CAS:Controlled ProductApplications (1R,2S,3R)-1-(2-Quinoxalinyl)-1,2,3,4-butanetetrol is an intermediate in the synthesis of 2-Quinoxalinecarboxylic Acid (Q765265), a residue of Carbadox (C175825) which is an antimicrobial drug.
References Harms, A.E., et al.: Org. Proc. Res. Develop., 8, 666 (2004);Formula:C12H14N2O4Color and Shape:NeatMolecular weight:250.25
