CAS 4714-14-1
:1,1'-(1-chloroethane-1,2-diyl)dibenzene
Description:
1,1'-(1-chloroethane-1,2-diyl)dibenzene, with the CAS number 4714-14-1, is an organic compound characterized by its structure, which features two benzene rings connected by a 1,1'-dichloroethane moiety. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits moderate solubility in organic solvents, such as ethanol and ether, while being less soluble in water due to its hydrophobic benzene rings. The presence of chlorine atoms in its structure contributes to its reactivity, making it susceptible to nucleophilic substitution reactions. Additionally, this compound may have applications in organic synthesis and as an intermediate in the production of various chemical products. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may pose health risks if inhaled or ingested. Overall, 1,1'-(1-chloroethane-1,2-diyl)dibenzene is a notable compound in the realm of organic chemistry.
Formula:C14H13Cl
InChI:InChI=1/C14H13Cl/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,14H,11H2
SMILES:c1ccc(cc1)CC(c1ccccc1)Cl
Synonyms:- 1,2-Diphenylchloroethane
- Benzene, 1,1'-(1-Chloro-1,2-Ethanediyl)Bis-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(2-Chloro-2-phenylethyl)benzene
CAS:2-Chloro-2-phenylethylbenzene is an organic compound that is used in the synthesis of other compounds. It is produced by reacting a chlorinated benzene with an alkali, such as sodium hydroxide, potassium hydroxide, or lithium hydroxide. The reaction produces a mixture of 2-chloro-2-phenylethylbenzene and phenylhydroxyethane. This compound can be converted to 2-chloro-2-(piperidin-1-yl)ethanol by refluxing it with morpholine in methanol and then adding amides such as piperidine or pyrrolidine. The resulting product can be alkylated with carbon tetrachloride to produce 2-chloro-2-(4'-methylphenoxy)ethanol. This compound can also be reduced to give 2-(4'-methylphenoxy)ethanol by heating it with sodium bor
Formula:C14H13ClPurity:Min. 95%Molecular weight:216.7 g/mol
