CAS 472-41-3
:Chroman I
Description:
Chroman I, also known as 2H-chromen-2-one, is a chemical compound characterized by its bicyclic structure that consists of a benzene ring fused to a pyran ring. It is classified as a flavonoid and is notable for its role in various biological activities, including antioxidant properties. The compound typically appears as a pale yellow to white crystalline solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. Chroman I is often studied for its potential applications in pharmaceuticals and natural product chemistry due to its ability to interact with various biological targets. Its molecular structure allows for various substitutions, which can influence its reactivity and biological activity. Additionally, Chroman I can be synthesized through various organic reactions, making it a compound of interest in synthetic organic chemistry. As with many chemical substances, safety precautions should be taken when handling Chroman I, as it may pose health risks if ingested or inhaled.
Formula:C18H20O2
InChI:InChI=1S/C18H20O2/c1-17(2)12-18(3,13-8-10-14(19)11-9-13)15-6-4-5-7-16(15)20-17/h4-11,19H,12H2,1-3H3
InChI key:InChIKey=KXYDGGNWZUHESZ-UHFFFAOYSA-N
SMILES:CC1(C=2C(OC(C)(C)C1)=CC=CC2)C3=CC=C(O)C=C3
Synonyms:- 2,2,4-Trimethyl-4-(4-hydroxyphenyl)chroman
- 4-(2,2,4-trimethyl-3,4-dihydro-2H-chromen-3-yl)phenol
- 4-(3,4-Dihydro-2,2,4-Trimethyl-2H-1-Benzopyran-4-Yl)Phenol
- 4-(4'-Hydroxyphenyl)-2,2,4-trimethylchroman
- 4-(4-Hydroxyphenyl)-2,2,4-trimethyl-4-chroman
- 4-(4-Hydroxyphenyl)-2,2,4-trimethylchromane
- 4-p-Hydroxyphenyl-2,2,4-trimethylchroman
- Chroman I
- Dianin's compound
- NSC 46014
- NSC 527817
- Nsc 39757
- Phenol, 4-(3,4-dihydro-2,2,4-trimethyl-2H-1-benzopyran-4-yl)-
- Phenol, p-(2,2,4-trimethyl-4-chromanyl)-
- p-(2,2,4-Trimethyl-4-chromanyl)phenol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
p-(3,4-dihydro-2,2,4-trimethyl-2H-1-benzopyran-4-yl)phenol
CAS:Formula:C18H20O2Purity:95%Color and Shape:SolidMolecular weight:268.35024-(2,2,4-Trimethylchroman-4-yl)phenol
CAS:4-(2,2,4-Trimethylchroman-4-yl)phenolPurity:95%Molecular weight:268.36g/mol4-P-Hydroxyphenyl-2,2,4-trimethylchroman
CAS:Controlled ProductApplications 4-P-HYDROXYPHENYL-2,2,4-TRIMETHYLCHROMAN (cas# 472-41-3) is a useful research chemical.
Formula:C18H20O2Color and Shape:NeatMolecular weight:268.364-(2,2,4-Trimethylchroman-4-yl)phenol
CAS:4-(2,2,4-Trimethylchroman-4-yl)phenol is a molecule that belongs to the group of aromatic hydrocarbons. It has a basic structure and a molecular weight of 288.44 g/mol. The chemical formula for 4-(2,2,4-Trimethylchroman-4-yl)phenol is C14H20O. This compound has an nmr spectrum with peaks at 3.97 ppm (1H), 7.70 ppm (1H), 8.40 ppm (1H), 9.29 ppm (1H), 10.94 ppm (1H), 11.81 ppm (1H). The acid complex formation constant for 4-(2,2,4-Trimethylchroman-4-yl)phenol is 1 x 10^8 L/mol/degree Celsius or K = 1 x 10^(-8). Trifluoroacetic acid can be used to dissolveFormula:C18H20O2Purity:Min. 95%Molecular weight:268.35 g/mol




