CAS 4720-09-6
:Grayanotoxin I
Description:
Grayanotoxin I is a toxic compound primarily found in certain species of plants, particularly those in the Ericaceae family, such as rhododendrons and azaleas. It is classified as a diterpenoid and is known for its potent effects on the nervous system. The compound acts as a sodium channel activator, leading to prolonged depolarization of nerve cells, which can result in various physiological effects, including cardiovascular disturbances and gastrointestinal symptoms when ingested. Grayanotoxin I is typically colorless to pale yellow and is soluble in organic solvents. Its toxicity can lead to a condition known as "mad honey disease" when honey produced from the nectar of these plants is consumed. The compound has garnered interest in pharmacological research due to its unique mechanism of action, although its toxic nature limits its therapeutic applications. Safety precautions are essential when handling or studying this substance due to its potential health risks.
Formula:C22H36O7
InChI:InChI=1S/C22H36O7/c1-11(23)29-17-12-6-7-13-20(5,27)14-8-15(24)18(2,3)22(14,28)16(25)9-21(13,17)10-19(12,4)26/h12-17,24-28H,6-10H2,1-5H3/t12-,13+,14+,15+,16-,17-,19-,20-,21+,22+/m1/s1
InChI key:InChIKey=NXCYBYJXCJWMRY-VGBBEZPXSA-N
SMILES:O(C(C)=O)[C@H]1[C@@]23[C@]([C@@](C)(O)[C@]4([C@](O)([C@H](O)C2)C(C)(C)[C@@H](O)C4)[H])(CC[C@]1([C@](C)(O)C3)[H])[H]
Synonyms:- Andromedotoxin
- 7,9a-Methano-9aH-cyclopenta[b]heptalene-2,4,8,11,11a,12(1H)-hexol, dodecahydro-1,1,4,8-tetramethyl-, 12-acetate, (2S,3aS,4R,4aR,7R,8R,9aS,11R,11aR,12R)-
- Grayanotoxin I
- Rhodotoxin
- Grayanotoxane-3,5,6,10,14,16-hexol, 14-acetate, (3β,6β,14R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Grayanotoxin i
CAS:Acetic acid esterFormula:C22H36O7Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:412.52Andromedotoxin
CAS:<p>Andromedotoxin is a naturally occurring toxin derived from the plants of the genus Rhododendron, known for its potent effects on ion channels within biological systems. This compound, primarily sourced from certain species within the Ericaceae family, functions by binding to sodium channels in nerve cells. By altering the permeability of these channels, it disrupts normal neuronal activity, leading to potential neurotoxic outcomes.</p>Formula:C22H36O7Purity:Min. 95%Color and Shape:PowderMolecular weight:412.52 g/molGrayanotoxin I
CAS:Grayanotoxin I is a natural product for research related to life sciences. The catalog number is TN4165 and the CAS number is 4720-09-6.Formula:C22H36O7Purity:98%Color and Shape:SolidMolecular weight:412.52Ref: 4Z-G-173002
Discontinued product



