CAS 4720-73-4

N-(Phenylmethyl)-1,3-benzodioxole-5-methanamine

Description:

N-(Phenylmethyl)-1,3-benzodioxole-5-methanamine, with the CAS number 4720-73-4, is a chemical compound that belongs to the class of substituted amines and dioxoles. This compound features a benzodioxole core, which is characterized by a fused dioxole ring system that contributes to its unique chemical properties. The presence of the phenylmethyl group enhances its aromatic character, potentially influencing its reactivity and interaction with biological systems. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The amine functional group suggests potential for hydrogen bonding, which can affect solubility and interaction with other molecules. Additionally, the structural features may impart specific electronic properties, influencing its behavior in chemical reactions. While detailed physical and chemical properties such as melting point, boiling point, and solubility are not specified here, they are essential for understanding the compound's applications and behavior in different environments. Overall, this compound's unique structure positions it as a candidate for further research in various chemical and biological contexts.

Formula: C₁₅H₁₅NO₂

InChI: InChI=1S/C15H15NO2/c1-2-4-12(5-3-1)9-16-10-13-6-7-14-15(8-13)18-11-17-14/h1-8,16H,9-11H2

InChI key: InChIKey=PUBLVNIUFCOQFU-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CC=C1)C=2C=C3C(=CC2)OCO3

Synonyms:

• N-Benzyl-N-(piperonyl)amine
• Dibenzylamine, 3,4-(methylenedioxy)-
• N-(Phenylmethyl)-1,3-benzodioxole-5-methanamine
• 1,3-Benzodioxole-5-methanamine, N-(phenylmethyl)-
• Piperonylamine, N-benzyl-