CAS 4724-89-4
:1,3,5,5-Tetramethyl-1,3-cyclohexadiene
Description:
1,3,5,5-Tetramethyl-1,3-cyclohexadiene is an organic compound characterized by its unique cyclic structure and the presence of multiple methyl groups. It features a cyclohexadiene framework, which includes two double bonds located at the 1 and 3 positions of the ring. The presence of four methyl groups at the 1, 3, and 5 positions contributes to its stability and influences its reactivity. This compound is typically colorless to pale yellow in appearance and is known for its distinct aromatic odor. It is relatively non-polar, which affects its solubility in various solvents. The compound can undergo typical reactions associated with alkenes, such as electrophilic addition and polymerization. Its structure allows for potential applications in organic synthesis and as a building block in the production of more complex molecules. However, due to its unsaturated nature, it may also be sensitive to oxidation and other reactions that can affect its stability. Safety precautions should be taken when handling this compound, as with many organic chemicals.
Formula:C10H16
InChI:InChI=1S/C10H16/c1-8-5-9(2)7-10(3,4)6-8/h5-6H,7H2,1-4H3
InChI key:InChIKey=SZHAWDAGEJWQJK-UHFFFAOYSA-N
SMILES:CC1(C)CC(C)=CC(C)=C1
Synonyms:- 1,3,5,5-Tetramethylcyclohexa-1,3-Diene
- 1,3-Cyclohexadiene, 1,3,5,5-tetramethyl-
- Nsc 123453
- 1,3,5,5-Tetramethyl-1,3-cyclohexadiene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3,5,5-Tetramethyl-1,3-cyclohexadiene
CAS:Formula:C10H16Color and Shape:LiquidMolecular weight:136.23401,3,5,5-Tetramethyl-1,3-Cyclohexadiene
CAS:1,3,5,5-Tetramethyl-1,3-CyclohexadienePurity:92%Molecular weight:136.24g/mol1,3,5,5-Tetramethyl-1,3-cyclohexadiene
CAS:Formula:C10H16Purity:>92.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:136.241,3,5,5-Tetramethyl-1,3-cyclohexadiene
CAS:1,3,5,5-Tetramethyl-1,3-cyclohexadiene is an organic compound that belongs to the group of cyclohexadienyls. It is a colorless liquid that has a sweet odor reminiscent of honey and bananas. 1,3,5,5-Tetramethyl-1,3-cyclohexadiene is used as a ligand in organometallic chemistry and as a precursor in organic synthesis. 1,3,5,5-Tetramethyl-1,3-cyclohexadiene can be prepared by reacting benzene with ethylene or other alpha olefins. This chemical can also be synthesized by irradiation of arenes in the presence of chlorine or chloride ions. Irradiation can also produce deuterated 1,3,5,5-tetramethyl-1,3-cyclohexadiene.Formula:C10H16Purity:90%MinColor and Shape:Clear LiquidMolecular weight:136.24 g/mol



