CAS 4726-22-1

2-Amino-4-[[2-(sulfooxy)ethyl]sulfonyl]phenol

Description:

2-Amino-4-[[2-(sulfooxy)ethyl]sulfonyl]phenol, with the CAS number 4726-22-1, is an organic compound characterized by its sulfonic acid and amino functional groups. This compound features a phenolic structure, which contributes to its potential as a dye intermediate or in various chemical syntheses. The presence of the sulfooxyethyl group enhances its solubility in water, making it useful in aqueous applications. Its amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are significant in organic synthesis. Additionally, the sulfonyl group imparts strong acidic properties, influencing the compound's reactivity and stability under different pH conditions. This compound may also exhibit biological activity, although specific biological properties would require further investigation. Overall, 2-Amino-4-[[2-(sulfooxy)ethyl]sulfonyl]phenol is notable for its functional versatility in chemical processes and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₈H₁₁NO₇S₂

InChI: InChI=1S/C8H11NO7S2/c9-7-5-6(1-2-8(7)10)17(11,12)4-3-16-18(13,14)15/h1-2,5,10H,3-4,9H2,(H,13,14,15)

InChI key: InChIKey=SLLSIPBBZZFAKY-UHFFFAOYSA-N

SMILES: S(CCOS(=O)(=O)O)(=O)(=O)C1=CC(N)=C(O)C=C1

Synonyms:

• Phenol, 2-amino-4-[[2-(sulfooxy)ethyl]sulfonyl]-
• 2-Amino-4-(β-sulfatoethylsulfonyl)phenol
• 2-Amino-4-[[2-(sulfooxy)ethyl]sulfonyl]phenol
• Ethanol, 2-[(3-amino-4-hydroxyphenyl)sulfonyl]-, 1-(hydrogen sulfate)
• 3-Amino-4-hydroxyphenyl 2-sulfatoethyl sulfone