
CAS 4728-04-5
:3-(2-Furanylmethylene)-2,4-pentanedione
Description:
3-(2-Furanylmethylene)-2,4-pentanedione, also known by its CAS number 4728-04-5, is an organic compound characterized by its unique structure that includes a furan ring and a diketone moiety. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic synthesis and as a building block in the development of various pharmaceuticals and agrochemicals. The presence of the furan ring contributes to its reactivity, particularly in electrophilic addition reactions, while the diketone functionality can participate in condensation reactions. Additionally, this compound may display interesting biological activities, making it a subject of interest in medicinal chemistry. Its solubility properties can vary depending on the solvent, and it is generally stable under standard laboratory conditions. However, like many organic compounds, it should be handled with care, considering potential toxicity and reactivity. Overall, 3-(2-Furanylmethylene)-2,4-pentanedione is a versatile compound with significant implications in chemical research and application.
Formula:C10H10O3
InChI:InChI=1S/C10H10O3/c1-7(11)10(8(2)12)6-9-4-3-5-13-9/h3-6H,1-2H3
InChI key:InChIKey=LYUYRWISWALFBB-UHFFFAOYSA-N
SMILES:C(=CC1=CC=CO1)(C(C)=O)C(C)=O
Synonyms:- 2,4-Pentanedione, 3-(2-furanylmethylene)-
- 3-(2-Furanylmethylene)-2,4-pentanedione
- 2,4-Pentanedione, 3-furfurylidene-
- 3-[(Furan-2-yl)methylidene]pentane-2,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.