CAS 4728-34-1
:octahydro-4,7-methano-1H-indene-1,2-diol
Description:
Octahydro-4,7-methano-1H-indene-1,2-diol, with the CAS number 4728-34-1, is a bicyclic organic compound characterized by its unique structure that includes a fused ring system. This compound features a diol functional group, indicating the presence of two hydroxyl (-OH) groups, which contributes to its reactivity and solubility in polar solvents. The bicyclic nature of octahydro-4,7-methano-1H-indene-1,2-diol imparts rigidity to its molecular structure, influencing its physical properties such as boiling and melting points. It is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. The compound is of interest in various chemical applications, including potential uses in organic synthesis and as a building block in the development of more complex molecules. Its specific interactions and reactivity can be influenced by the presence of the hydroxyl groups, making it a versatile compound in both industrial and research settings. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H16O2
InChI:InChI=1/C10H16O2/c11-8-4-7-5-1-2-6(3-5)9(7)10(8)12/h5-12H,1-4H2
InChI key:InChIKey=XZDKBXDSOIMBNM-UHFFFAOYSA-N
SMILES:OC1C2C(C3CC2CC3)CC1O
Synonyms:- 4,7-Methano-1H-indene-1,2-diol, octahydro-
- 4,7-Methanoindan-1,2-diol, hexahydro-
- 4,7-Methanoindan-1,2-diol, hexahydro-, endo-
- NSC 157456
- octahydro-1H-4,7-methanoindene-1,2-diol
- Octahydro-4,7-methano-1H-indene-1,2-diol
- XZDKBXDSOIMBNM-UHFFFAOYSA-N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.