
CAS 4728-82-9
:Allyl cyclohexylacetate
Description:
Allyl cyclohexylacetate, with the CAS number 4728-82-9, is an organic compound that belongs to the class of esters. It is characterized by its pleasant, fruity odor, making it useful in the fragrance and flavoring industries. The molecular structure consists of an allyl group attached to a cyclohexylacetate moiety, which contributes to its unique aromatic properties. This compound is typically colorless to pale yellow in appearance and is soluble in organic solvents. Its boiling point and density can vary, but it generally exhibits moderate volatility. Allyl cyclohexylacetate is often utilized in the formulation of perfumes, cosmetics, and food flavorings due to its appealing scent profile. Additionally, it may have applications in the synthesis of other chemical compounds. As with many organic substances, safety precautions should be taken when handling it, as it may cause irritation to the skin and eyes. Overall, allyl cyclohexylacetate is valued for its aromatic qualities and versatility in various applications.
Formula:C11H18O2
InChI:InChI=1S/C11H18O2/c1-2-8-13-11(12)9-10-6-4-3-5-7-10/h2,10H,1,3-9H2
InChI key:InChIKey=UECFOOSFSUDPOR-UHFFFAOYSA-N
SMILES:C(C(OCC=C)=O)C1CCCCC1
Synonyms:- Cyclohexaneacetic acid, allyl ester
- Cyclohexaneacetic acid, 2-propenyl ester
- Cyclohexaneacetic acid, 2-propen-1-yl ester
- Allyl cyclohexaneacetate
- Allyl cyclohexylacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.