CAS 4728-91-0
:Spiro[4.5]decan-1-one
Description:
Spiro[4.5]decan-1-one is a bicyclic organic compound characterized by its unique spiro structure, which consists of two fused rings sharing a single carbon atom. This compound features a ketone functional group at the 1-position, contributing to its reactivity and potential applications in organic synthesis. The molecular formula of spiro[4.5]decan-1-one reflects its composition of carbon and hydrogen atoms, typical of many cyclic ketones. It is generally a colorless to pale yellow liquid with a distinctive odor, and its physical properties include moderate volatility and solubility in organic solvents. The compound's spiro configuration imparts unique stereochemical properties, making it of interest in the fields of medicinal chemistry and materials science. Additionally, spiro[4.5]decan-1-one can participate in various chemical reactions, including nucleophilic additions and cycloadditions, which can be exploited in synthetic pathways to create more complex molecules. Its CAS number, 4728-91-0, is a unique identifier that facilitates its recognition in chemical databases and literature.
Formula:C10H16O
InChI:InChI=1S/C10H16O/c11-9-5-4-8-10(9)6-2-1-3-7-10/h1-8H2
InChI key:InChIKey=FPVZWDQWFCGSFY-UHFFFAOYSA-N
SMILES:O=C1C2(CCC1)CCCCC2
Synonyms:- Spiro[4.5]decan-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Spiro[4.5]decan-1-one
CAS:<p>Spiro[4.5]decan-1-one is a synthetic drug that has been shown to have affinity for cardiac, neuropathic, and depression receptors. It also has moderate affinity for the acetylcholine receptor in the brain and acts as a stabilizer. Spiro[4.5]decan-1-one may be useful in treating Alzheimer's disease, Parkinson's disease, chronic pain, and psychosis because it can stabilize neuronal membranes and prevent cell damage caused by free radicals. This compound may also be used to treat cognitive disorders such as memory loss and attention deficit hyperactivity disorder (ADHD).<br>Spiro[4.5]decan-1-one is a nitrogenous compound that has been shown to have anticholinergic effects on cognition in rats. It is thought that its effects are mediated through its ability to block the action of acetylcholinesterase enzymes that break down acetylcholine at synapses in the brain.</p>Formula:C10H16OPurity:Min. 95%Molecular weight:152.23 g/mol

