CAS 472958-69-3

1,2-difluoro-4-isocyanobenzene

Description:

1,2-Difluoro-4-isocyanobenzene, with the CAS number 472958-69-3, is an organic compound characterized by the presence of two fluorine atoms and an isocyanate functional group attached to a benzene ring. The fluorine atoms are positioned at the 1 and 2 positions of the benzene ring, while the isocyanate group is located at the 4 position, contributing to the compound's reactivity and potential applications in various chemical syntheses. This compound is typically a colorless to pale yellow solid and may exhibit moderate solubility in organic solvents. Its isocyanate group makes it a versatile intermediate in the synthesis of pharmaceuticals, agrochemicals, and polymers. The presence of fluorine can enhance the compound's stability and lipophilicity, influencing its behavior in biological systems and its interactions with other chemicals. Safety precautions should be taken when handling this compound, as isocyanates are known to be toxic and can cause respiratory irritation. Overall, 1,2-difluoro-4-isocyanobenzene is a significant compound in organic chemistry with various potential applications.

Formula: C₇H₃F₂N

InChI: InChI=1/C7H3F2N/c1-10-5-2-3-6(8)7(9)4-5/h2-4H

SMILES: [C-]#[N+]c1ccc(c(c1)F)F

Synonyms:

• 3,4-Difluorophenyl isocyanide
• Benzene, 1,2-Difluoro-4-Isocyano-