
CAS 472964-21-9
:3′-(Trifluoromethyl)[1,1′-biphenyl]-4-methanamine
Description:
3′-(Trifluoromethyl)[1,1′-biphenyl]-4-methanamine, identified by its CAS number 472964-21-9, is an organic compound characterized by the presence of a biphenyl structure substituted with a trifluoromethyl group and a methanamine functional group. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can significantly influence the compound's reactivity and solubility. The biphenyl moiety contributes to the compound's stability and hydrophobic characteristics, making it less soluble in polar solvents. The methanamine group (-NH2) introduces basicity and potential for hydrogen bonding, which can affect the compound's interactions in biological systems or chemical reactions. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features that can modulate biological activity or physical properties. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C14H12F3N
InChI:InChI=1S/C14H12F3N/c15-14(16,17)13-3-1-2-12(8-13)11-6-4-10(9-18)5-7-11/h1-8H,9,18H2
InChI key:InChIKey=JQLZMRAHLKTQOJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1)C2=CC=C(CN)C=C2
Synonyms:- [1,1′-Biphenyl]-4-methanamine, 3′-(trifluoromethyl)-
- (3′-Trifluoromethyl-biphenyl-4-yl)methylamine
- [4-[3-(Trifluoromethyl)phenyl]phenyl]methanamine
- 3′-(Trifluoromethyl)[1,1′-biphenyl]-4-methanamine
- 3′-(Trifluoromethyl)-biphenyl-4-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.