CAS 473-13-2
:α-Selinene
Description:
α-Selinene is a naturally occurring sesquiterpene hydrocarbon, primarily found in various essential oils, particularly those derived from plants in the Apiaceae family, such as celery and carrot. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties and aromatic profile. α-Selinene is typically a colorless to pale yellow liquid with a distinct earthy, herbal scent. It has a relatively low boiling point and is insoluble in water but soluble in organic solvents. This compound exhibits various biological activities, including antimicrobial and antifungal properties, making it of interest in both the pharmaceutical and cosmetic industries. Additionally, α-selinene can undergo various chemical reactions, such as oxidation and polymerization, under specific conditions. Its presence in essential oils not only contributes to flavor and fragrance but also plays a role in the plant's defense mechanisms against pests and pathogens. Overall, α-selinene is a significant compound in natural product chemistry with potential applications in multiple fields.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14+,15-/m1/s1
InChI key:InChIKey=OZQAPQSEYFAMCY-QLFBSQMISA-N
SMILES:C[C@]12[C@@](C[C@H](C(C)=C)CC1)(C(C)=CCC2)[H]
Synonyms:- (-)-α-Selinene
- (2R,4aR,8aR)-1,2,3,4,4a,5,6,8a-Octahydro-4a,8-dimethyl-2-(1-methylethenyl)naphthalene
- (2R-(2alpha,4aalpha,8abeta))-1,2,3,4,4a,5,6,8a-Octahydro-4a,8-dimethyl-2-(1-methylethenyl)naphthalene
- 4A,8-Dimethyl-2-(Prop-1-En-2-Yl)-1,2,3,4,4A,5,6,8A-Octahydronaphthalene
- Eudesma-3,11-diene
- Naphthalene, 1,2,3,4,4a,5,6,8a-octahydro-4a,8-dimethyl-2-(1-methylethenyl)-, (2R,4aR,8aR)-
- Naphthalene, 1,2,3,4,4a,5,6,8a-octahydro-4a,8-dimethyl-2-(1-methylethenyl)-, (2R-(2alpha,4aalpha,8abeta))-
- Naphthalene, 1,2,3,4,4a,5,6,8a-octahydro-4a,8-dimethyl-2-(1-methylethenyl)-, [2R-(2α,4aα,8aβ)]-
- Selina-3,11-diene
- α-Selinine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
α-Selinine, >85%
CAS:<p>Applications α-Selinine is a natural product found in essential oils from variety of plants. It is a functional antioxidant with antiradical and antimicrobial properties.<br>References Sacchetti, G., et al.: Food Chem., 91, 621 (2005); Bozin, B., et al.: J. Agric. Food Chem., 54, 1822 (2006); Kiralan, M., et al.: Nat. Prod. Res., 26, 132 (2012);<br></p>Formula:C15H24Purity:>85%Color and Shape:NeatMolecular weight:204.35α-Selinine
CAS:alpha-Selinine is a sesquiterpene compound, which is a naturally occurring organic molecule. It is extracted primarily from the essential oils of certain plant species, such as those within the Apiaceae family, including celery and parsley. The compound’s mode of action involves interactions at the molecular level with cellular targets, which can influence a range of biological pathways. Studies suggest that alpha-Selinine may exhibit various bioactivities, including antimicrobial, anti-inflammatory, and antioxidant effects, by modulating enzyme activity and cell signaling pathways.Formula:C15H24Purity:85%MinMolecular weight:204.35 g/mol

