CAS 473-72-3: Pinonic acid

Description:Pinonic acid, with the CAS number 473-72-3, is a bicyclic organic compound that belongs to the class of carboxylic acids. It is derived from pinene, a common terpene found in pine trees. Pinonic acid typically appears as a colorless to pale yellow liquid with a characteristic odor reminiscent of pine. Its molecular structure features a bicyclo[3.3.0]octane framework, which contributes to its unique chemical properties. The compound is known for its moderate solubility in water and higher solubility in organic solvents such as ethanol and ether. Pinonic acid exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and oxidation. It is often studied for its potential applications in the synthesis of fragrances, flavoring agents, and as a building block in organic synthesis. Additionally, pinonic acid can serve as a marker for biogenic emissions and is of interest in atmospheric chemistry due to its role in the formation of secondary organic aerosols.

Formula:C₁₀H₁₆O₃

InChI:InChI=1S/C10H16O3/c1-6(11)8-4-7(5-9(12)13)10(8,2)3/h7-8H,4-5H2,1-3H3,(H,12,13)

InChI key:InChIKey=SIZDUQQDBXJXLQ-UHFFFAOYSA-N

SMILES:O=C(O)CC1CC(C(=O)C)C1(C)C

Synonyms:
(3-Acetyl-2,2-Dimethylcyclobutyl)Acetic Acid
2-(3-Acetyl-2,2-dimethylcyclobutyl)acetic acid
3-Acetyl-2,2-dimethylcyclobutaneacetic acid
Cyclobutaneacetic acid, 3-acetyl-2,2-dimethyl-
NSC 29469
NSC 46248
NSC 96748
Pinonic acid
cis-3-Acetyl-2,2-dimethylcyclobutaneacetic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
PINONIC ACID REF: IN-DA00DG5OCAS: 473-72-3	- - -	To inquire	Mon 14 Apr 25
Pinonic Acid REF: TR-P468550CAS: 473-72-3	- - -	1,206.00 €	Thu 24 Apr 25
Pinonic acid REF: 3D-FP67098CAS: 473-72-3	Min. 95%	152.00 €~439.00 €	Fri 25 Apr 25
2-(3-Acetyl-2,2-dimethylcyclobutyl)acetic acid REF: 10-F740081CAS: 473-72-3	98+%	- - -	Discontinued product