CAS 473-72-3
:Pinonic acid
Description:
Pinonic acid, with the CAS number 473-72-3, is a bicyclic organic compound that belongs to the class of carboxylic acids. It is derived from pinene, a common terpene found in pine trees. Pinonic acid typically appears as a colorless to pale yellow liquid with a characteristic odor reminiscent of pine. Its molecular structure features a bicyclo[3.3.0]octane framework, which contributes to its unique chemical properties. The compound is known for its moderate solubility in water and higher solubility in organic solvents such as ethanol and ether. Pinonic acid exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and oxidation. It is often studied for its potential applications in the synthesis of fragrances, flavoring agents, and as a building block in organic synthesis. Additionally, pinonic acid can serve as a marker for biogenic emissions and is of interest in atmospheric chemistry due to its role in the formation of secondary organic aerosols.
Formula:C10H16O3
InChI:InChI=1S/C10H16O3/c1-6(11)8-4-7(5-9(12)13)10(8,2)3/h7-8H,4-5H2,1-3H3,(H,12,13)
InChI key:InChIKey=SIZDUQQDBXJXLQ-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C(C)(C)C(C(C)=O)C1
Synonyms:- (3-Acetyl-2,2-Dimethylcyclobutyl)Acetic Acid
- 2-(3-Acetyl-2,2-dimethylcyclobutyl)acetic acid
- 3-Acetyl-2,2-dimethylcyclobutaneacetic acid
- Cyclobutaneacetic acid, 3-acetyl-2,2-dimethyl-
- NSC 29469
- NSC 46248
- NSC 96748
- Pinonic acid
- cis-3-Acetyl-2,2-dimethylcyclobutaneacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(3-Acetyl-2,2-dimethylcyclobutyl)acetic acid
CAS:Formula:C10H16O3Color and Shape:SolidMolecular weight:184.2322Pinonic Acid
CAS:<p>Applications Pinonic Acid is identified as a low-volatility species produced in the atmosphere when α-pinene undergoes reactions with ozone, OH radical or NO3 radical.<br>References Zhang, X., et al.: Proc. Natl. Acad. Sci. U.S.A., 112, 14168 (2015);<br></p>Formula:C10H16O3Color and Shape:NeatMolecular weight:184.23Pinonic acid
CAS:<p>Pinonic acid is a fatty acid that is found in particle form. It can be found as an α-pinene terpene, and it is produced by the oxidation of pinene. Pinonic acid has been observed to form from anthropogenic emissions, such as those from fossil fuel combustion. It has also been identified in water vapor and in the atmosphere at high values. Pinonic acid forms through a chemical reaction involving intramolecular hydrogen transfer, which leads to its formation rate and analytical method. The structure of pinonic acid was determined by x-ray crystallography.</p>Formula:C10H16O3Purity:Min. 95%Molecular weight:184.23 g/mol


